CymitQuimica logo

CAS 22236-04-0

:

2-(difluoromethoxy)aniline

Description:
2-(Difluoromethoxy)aniline is an organic compound characterized by the presence of an aniline group substituted with a difluoromethoxy functional group. Its molecular structure features a benzene ring bonded to an amino group (-NH2) and a difluoromethoxy group (-O-CHF2) at the ortho position relative to the amino group. This compound is typically a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. It is known for its potential applications in pharmaceuticals and agrochemicals due to the presence of both the aniline and difluoromethoxy moieties, which can influence its reactivity and biological activity. The difluoromethoxy group can enhance lipophilicity and metabolic stability, making it an interesting candidate for drug development. Additionally, the compound may exhibit specific solubility characteristics and reactivity patterns, influenced by the electronegative fluorine atoms, which can affect hydrogen bonding and overall molecular interactions. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C7H7F2NO
InChI:InChI=1/C7H7F2NO/c8-7(9)11-6-4-2-1-3-5(6)10/h1-4,7H,10H2
InChI key:CGNAIUUCOVWLLL-UHFFFAOYSA-N
SMILES:c1ccc(c(c1)N)OC(F)F
Synonyms:
  • 2-Difluoromethoxyaniline
Found 3 products.