CymitQuimica logo

CAS 22236-12-0

:

1,3-bis(difluoromethoxy)benzene

Description:
1,3-Bis(difluoromethoxy)benzene, with the CAS number 22236-12-0, is an organic compound characterized by its aromatic structure featuring two difluoromethoxy groups attached to a benzene ring at the 1 and 3 positions. This compound is a colorless to pale yellow liquid or solid, depending on temperature and purity. The presence of difluoromethoxy groups imparts unique chemical properties, including increased polarity and potential reactivity, making it useful in various chemical syntheses and applications. It is generally insoluble in water but soluble in organic solvents, which is typical for many fluorinated compounds. The difluoromethoxy substituents enhance the compound's stability and may influence its electronic properties, making it of interest in materials science and pharmaceuticals. Safety data should be consulted, as fluorinated compounds can exhibit toxicity and environmental persistence. Overall, 1,3-bis(difluoromethoxy)benzene is a notable compound in the field of organic chemistry, particularly for its unique structural and functional characteristics.
Formula:C8H6F4O2
InChI:InChI=1/C8H6F4O2/c9-7(10)13-5-2-1-3-6(4-5)14-8(11)12/h1-4,7-8H
InChI key:WKUYZOKJVGOZNE-UHFFFAOYSA-N
SMILES:c1cc(cc(c1)OC(F)F)OC(F)F
Synonyms:
  • Benzene, 1,3-bis(difluoromethoxy)-
Found 4 products.