CymitQuimica logo

CAS 2227206-61-1

:

1,1-Dimethylethyl 1-methyl-3-oxocyclobutanecarboxylate

Description:
1,1-Dimethylethyl 1-methyl-3-oxocyclobutanecarboxylate, identified by its CAS number 2227206-61-1, is an organic compound characterized by its unique structure that includes a cyclobutane ring and various functional groups. This compound features a carboxylate ester functional group, which contributes to its reactivity and potential applications in organic synthesis. The presence of the 1,1-dimethylethyl group indicates steric hindrance, which can influence the compound's physical properties, such as boiling point and solubility. Additionally, the ketone functionality (3-oxocyclobutane) suggests that it may participate in various chemical reactions, including nucleophilic additions and condensation reactions. The compound's molecular structure may also impart specific characteristics such as stability under certain conditions and potential uses in pharmaceuticals or agrochemicals. However, detailed information regarding its toxicity, environmental impact, and specific applications would require further investigation and analysis. Overall, this compound exemplifies the complexity and diversity of organic chemistry, showcasing the interplay between structure and reactivity.
Formula:C10H16O3
InChI:InChI=1S/C10H16O3/c1-9(2,3)13-8(12)10(4)5-7(11)6-10/h5-6H2,1-4H3
InChI key:InChIKey=BMCGXZKINIZDMH-UHFFFAOYSA-N
SMILES:C(OC(C)(C)C)(=O)C1(C)CC(=O)C1
Synonyms:
  • Cyclobutanecarboxylic acid, 1-methyl-3-oxo-, 1,1-dimethylethyl ester
  • 1,1-Dimethylethyl 1-methyl-3-oxocyclobutanecarboxylate
Found 3 products.