CymitQuimica logo

CAS 22287-28-1

:

Bicyclo[1.1.1]pentane-1-carboxylic acid

Description:
Bicyclo[1.1.1]pentane-1-carboxylic acid is a bicyclic organic compound characterized by its unique structure, which consists of a bicyclo[1.1.1]pentane framework with a carboxylic acid functional group. This compound features a rigid, three-dimensional arrangement due to the bicyclic system, which can influence its reactivity and physical properties. The presence of the carboxylic acid group imparts acidic characteristics, allowing it to participate in various chemical reactions, such as esterification and amidation. Bicyclo[1.1.1]pentane derivatives are of interest in synthetic organic chemistry and materials science due to their potential applications in drug design and the development of novel materials. The compound is typically colorless and may exhibit moderate solubility in polar solvents. Its unique structural features can lead to interesting conformational behavior and steric interactions, making it a subject of study in both theoretical and applied chemistry. Overall, bicyclo[1.1.1]pentane-1-carboxylic acid represents a fascinating example of bicyclic compounds with diverse chemical properties.
Formula:C6H8O2
InChI:InChI=1S/C6H8O2/c7-5(8)6-1-4(2-6)3-6/h4H,1-3H2,(H,7,8)
InChI key:ORCXPYPDHLVQFP-UHFFFAOYSA-N
SMILES:C1C2CC1(C2)C(=O)O
Found 6 products.