
CAS 222973-44-6
:1-[(5-Formyl-2-furanyl)methyl] 2-hydroxy-1,2,3-propanetricarboxylate
Description:
1-[(5-Formyl-2-furanyl)methyl] 2-hydroxy-1,2,3-propanetricarboxylate, with the CAS number 222973-44-6, is a chemical compound characterized by its complex structure, which includes a furan ring and multiple carboxylate groups. This compound features a formyl group attached to a furan moiety, contributing to its potential reactivity and biological activity. The presence of three carboxylate groups indicates that it can act as a tricarboxylic acid, which may influence its solubility and acidity in aqueous solutions. The hydroxyl group enhances its potential for hydrogen bonding, which can affect its interactions with other molecules. This compound may exhibit interesting properties in organic synthesis and could have applications in pharmaceuticals or agrochemicals due to the presence of the furan ring, which is often associated with various biological activities. Overall, its unique structural features suggest that it may possess significant chemical reactivity and potential utility in various fields of research.
Formula:C12H12O9
InChI:InChI=1S/C12H12O9/c13-5-7-1-2-8(21-7)6-20-10(16)4-12(19,11(17)18)3-9(14)15/h1-2,5,19H,3-4,6H2,(H,14,15)(H,17,18)
InChI key:InChIKey=FYDIRKLRXHXXHY-UHFFFAOYSA-N
SMILES:C(OC(CC(CC(O)=O)(C(O)=O)O)=O)C=1OC(C=O)=CC1
Synonyms:- Mumefural
- 1-[(5-Formyl-2-furanyl)methyl] 2-hydroxy-1,2,3-propanetricarboxylate
- 1,2,3-Propanetricarboxylic acid, 2-hydroxy-, 1-[(5-formyl-2-furanyl)methyl] ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Mumefural
CAS:Mumefural, from Prunus mume fruit, hinders platelets, has anti-thrombotic properties, and boosts cognition.Formula:C12H12O9Color and Shape:SolidMolecular weight:300.22
