CymitQuimica logo

CAS 22300-56-7

:

4-Methyl-2-phenyl-1,2,3-triazole-5-carboxylic acid

Description:
4-Methyl-2-phenyl-1,2,3-triazole-5-carboxylic acid is a heterocyclic organic compound characterized by the presence of a triazole ring, which is a five-membered ring containing three nitrogen atoms. This compound features a carboxylic acid functional group, contributing to its acidic properties. The methyl and phenyl substituents enhance its structural complexity and may influence its solubility and reactivity. Typically, compounds of this nature exhibit biological activity, making them of interest in pharmaceutical and agricultural research. The presence of the triazole moiety is often associated with antifungal and antimicrobial properties. Additionally, the compound may participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions, due to the functional groups present. Its solubility can vary depending on the solvent, and it may exhibit different physical properties such as melting point and boiling point, which are essential for practical applications. Overall, 4-Methyl-2-phenyl-1,2,3-triazole-5-carboxylic acid is a versatile compound with potential applications in various fields of chemistry and biochemistry.
Formula:C10H8N3O2
InChI:InChI=1/C10H9N3O2/c1-7-9(10(14)15)12-13(11-7)8-5-3-2-4-6-8/h2-6H,1H3,(H,14,15)/p-1
InChI key:GQYQHAGPALBYDO-UHFFFAOYSA-N
SMILES:Cc1c(C(=O)[O-])nn(c2ccccc2)n1
Synonyms:
  • 5-Methyl-2-phenyl-2H-1,2,3-triazole-4-carboxylic acid
  • 5-methyl-2-phenyl-2H-1,2,3-triazole-4-carboxylate
Found 3 products.