CymitQuimica logo

CAS 22308-09-4

:

cyclobutane-1,1-diyldimethanediyl bis(4-methylbenzenesulfonate)

Description:
Cyclobutane-1,1-diyldimethanediyl bis(4-methylbenzenesulfonate), with the CAS number 22308-09-4, is a chemical compound characterized by its unique structure that includes a cyclobutane ring and two sulfonate groups derived from 4-methylbenzenesulfonic acid. This compound typically exhibits properties associated with sulfonate esters, such as high solubility in polar organic solvents and potential reactivity in nucleophilic substitution reactions. The presence of the cyclobutane moiety may impart strain, influencing its reactivity and stability. Additionally, the sulfonate groups enhance its ability to act as a leaving group in chemical reactions, making it useful in synthetic organic chemistry. The compound may also exhibit interesting thermal and photochemical properties due to its structural features. Overall, cyclobutane-1,1-diyldimethanediyl bis(4-methylbenzenesulfonate) is a versatile compound with applications in various fields, including materials science and organic synthesis.
Formula:C20H24O6S2
InChI:InChI=1/C20H24O6S2/c1-16-4-8-18(9-5-16)27(21,22)25-14-20(12-3-13-20)15-26-28(23,24)19-10-6-17(2)7-11-19/h4-11H,3,12-15H2,1-2H3
InChI key:DBCZPSPFUJJRSK-UHFFFAOYSA-N
SMILES:Cc1ccc(cc1)S(=O)(=O)OCC1(CCC1)COS(=O)(=O)c1ccc(C)cc1
Found 2 products.