CAS 22327-82-8
:2,3,16,23,24-pentahydroxyolean-12-en-28-oic acid
Description:
2,3,16,23,24-pentahydroxyolean-12-en-28-oic acid, also known by its CAS number 22327-82-8, is a triterpenoid compound derived from the oleanane family. This substance is characterized by its complex structure, featuring multiple hydroxyl (-OH) groups that contribute to its solubility and reactivity. The presence of these hydroxyl groups enhances its potential biological activity, making it of interest in pharmacological research. It typically exhibits anti-inflammatory, antioxidant, and potential anticancer properties, which are common among many triterpenoids. The oleanene backbone provides a rigid structure, while the functional groups allow for various interactions with biological molecules. This compound is often studied in the context of natural products and herbal medicine, where it may be isolated from plant sources. Its stability and reactivity can vary depending on environmental conditions, such as pH and temperature, which are important considerations in both laboratory and therapeutic applications. Overall, 2,3,16,23,24-pentahydroxyolean-12-en-28-oic acid represents a significant area of interest in natural product chemistry and medicinal research.
Formula:C30H48O7
InChI:InChI=1/C30H48O7/c1-25(2)10-11-30(24(36)37)18(12-25)17-6-7-20-26(3)13-19(33)23(35)29(15-31,16-32)21(26)8-9-27(20,4)28(17,5)14-22(30)34/h6,18-23,31-35H,7-16H2,1-5H3,(H,36,37)
SMILES:CC1(C)CCC2(C(C1)C1=CCC3C4(C)CC(C(C(CO)(CO)C4CCC3(C)C1(C)CC2O)O)O)C(=O)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2β,3β,16α,23,24-Pentahydroxyolean-12-en-28-oic acid
CAS:Formula:C30H48O7Purity:98%Molecular weight:520.6979Platicodigenin
CAS:Platicodigenin (Platycodigenin) isolated from platycodon grandiflorum, has in vitro anti-proliferative activity against the HSC-T6 cell line.Formula:C30H48O7Purity:98.61%Color and Shape:SolidMolecular weight:520.7Platycodigenin
CAS:Controlled ProductPlatycodigenin is a triterpenoid saponin, which is a type of natural glycoside compound, derived from the root of Platycodon grandiflorus, commonly known as balloon flower. This compound is characterized by its ability to modulate biological pathways through its amphipathic structure, which allows it to interact with lipid bilayers and proteins in cell membranes.
Formula:C30H48O7Purity:Min. 95%Color and Shape:PowderMolecular weight:520.71 g/mol






