CAS 22338-71-2
:Polygalacic acid
Description:
Polygalacic acid, identified by its CAS number 22338-71-2, is a naturally occurring polysaccharide derived from the plant genus Polygala. It is primarily known for its role as a bioactive compound with potential therapeutic properties. Polygalacic acid exhibits characteristics typical of polysaccharides, including solubility in water and the ability to form gels or viscous solutions. Its structure is characterized by a backbone of sugar units linked by glycosidic bonds, which can influence its biological activity and interactions with other molecules. This compound has garnered interest in various fields, including pharmacology and food science, due to its potential antioxidant, anti-inflammatory, and immunomodulatory effects. Additionally, polygalacic acid may play a role in enhancing the bioavailability of certain nutrients and compounds, making it a subject of research in nutritional and medicinal applications. Overall, its unique properties and potential health benefits make polygalacic acid a noteworthy substance in both natural product chemistry and applied sciences.
Formula:C30H48O6
InChI:InChI=1/C30H48O6/c1-25(2)11-12-30(24(35)36)18(13-25)17-7-8-21-26(3)14-19(32)23(34)27(4,16-31)20(26)9-10-28(21,5)29(17,6)15-22(30)33/h7,18-23,31-34H,8-16H2,1-6H3,(H,35,36)/t18-,19-,20+,21+,22+,23-,26-,27-,28+,29+,30+/m0/s1
InChI key:KGGGRGBDMBZXKF-PWFIOIGMSA-N
SMILES:C[C@@]12CC[C@@H]3[C@@]([C@H]1CC=C4[C@]2(C[C@H]([C@@]5([C@H]4CC(CC5)(C)C)C(=O)O)O)C)(C[C@@H]([C@@H]([C@@]3(C)CO)O)O)C
Synonyms:- (2b,3b,4a,16a)-2,3,16,23-Tetrahydroxyolean-12-en-28-oic acid
- (2Beta,3Beta,5Xi,16Alpha,18Alpha)-2,3,16,23-Tetrahydroxyolean-12-En-28-Oic Acid
- (2Beta,3Beta,16Alpha)-2,3,16,23-Tetrahydroxyolean-12-En-28-Oic Acid
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Polygalacic acid
CAS:Polygalacic acid (Virgaureagenin G) is a triterpenoid isolated from the root of Polygala tenuifolia Willd.Cost-effective and quality-assured.Formula:C30H48O6Purity:98.11% - 99.82%Color and Shape:White SolidMolecular weight:504.6985Polygalacic acid (Standard)
CAS:Polygalacic acid (Standard) is a reference standard for research and analysis in studies involving Polygalacic acid. Polygalacic acid (Virgaureagenin G) is a triterpenoid isolated from the root of Polygala tenuifolia Willd that inhibits MMP expression. Polygalacic acid (Virgaureagenin G) can significantly improve the responsiveness of the cholinergic system, such as decreased acetylcholinesterase (AChE) activity, increased choline acetyltransferase (ChAT) activity, and increased acetylcholine (ACh) levels in the hippocampus and frontal cortex. Polygalacic acid (Virgaureagenin G) can also inhibit IL-1β-induced Wnt/β-catenin activation and mitogen-activated protein kinase (MAPK) signaling pathways in chondrocytes, and is used in osteoarthritis (OA) related research.Formula:C30H48O6Color and Shape:SolidMolecular weight:504.6985Polygalacic acid
CAS:Controlled ProductPolygalacic acid is a biodegradable polymer, which is derived from natural and renewable sources such as plant-based materials. It operates through a mode of action involving hydrolytic degradation where the polymer chains are broken down into non-toxic byproducts, typically under physiological conditions. This feature makes it highly suitable for biomedical applications where controlled degradation is crucial.
Formula:C30H48O6Purity:Min. 98 Area-%Color and Shape:PowderMolecular weight:504.7 g/mol
