CAS 223488-57-1

2-[3-[N-(4-tert-Butylbenzyl)-N-(pyridin-3-ylsulfonyl)aminomethyl]phenoxy]acetic acid

Description:

2-[3-[N-(4-tert-Butylbenzyl)-N-(pyridin-3-ylsulfonyl)aminomethyl]phenoxy]acetic acid, with CAS number 223488-57-1, is a synthetic organic compound characterized by its complex structure, which includes a phenoxyacetic acid moiety and a sulfonamide group. This compound typically exhibits properties associated with both acidic and basic functional groups, allowing it to participate in various chemical reactions. It is likely to be soluble in polar solvents due to the presence of the sulfonamide and carboxylic acid functionalities, while the tert-butyl group may enhance its lipophilicity. The compound may also exhibit biological activity, potentially acting as a pharmacological agent, given its structural features that resemble those of known drug candidates. Its synthesis involves multiple steps, including the formation of the sulfonamide and the coupling of the phenoxyacetic acid. As with many complex organic compounds, its stability, reactivity, and potential applications would depend on specific conditions such as pH, temperature, and the presence of other reagents.

Formula: C₂₅H₂₈N₂O₅S

InChI: InChI=1S/C25H28N2O5S/c1-25(2,3)21-11-9-19(10-12-21)16-27(33(30,31)23-8-5-13-26-15-23)17-20-6-4-7-22(14-20)32-18-24(28)29/h4-15H,16-18H2,1-3H3,(H,28,29)

InChI key: WOHRHWDYFNWPNG-UHFFFAOYSA-N

SMILES: CC(C)(C)C1=CC=C(C=C1)CN(CC2=CC(=CC=C2)OCC(=O)O)S(=O)(=O)C3=CN=CC=C3

Synonyms:

• Cp-533536

Evatanepag

CAS: 223488-57-1

Evatanepag (CP-533536) is a selective EP2 agonist for bone formation with 0.3 nM EC50, promoting fracture healing in rats.

Formula: C₂₅H₂₈N₂O₅S

Purity: 97.09%

Color and Shape: Solid

Molecular weight: 468.565

Ref: TM-T15259

Evatanepag

CAS: 223488-57-1

Evatanepag

Formula: C₂₅H₂₈N₂O₅S

Purity: ≥95%

Molecular weight: 468.57

Ref: 54-BUP04365

2-(3-((N-(4-(Tert-Butyl)Benzyl)Pyridine-3-Sulfonamido)Methyl)Phenoxy)Acetic Acid

CAS: 223488-57-1

2-(3-((N-(4-(Tert-Butyl)Benzyl)Pyridine-3-Sulfonamido)Methyl)Phenoxy)Acetic Acid

Formula: C₂₅H₂₈N₂O₅S

Purity: 98%

Molecular weight: 468.57

Ref: 54-OR1023057

2-(3-((N-(4-(Tert-Butyl)Benzyl)Pyridine-3-Sulfonamido)Methyl)Phenoxy)Acetic Acid

CAS: 223488-57-1

Formula: C₂₅H₂₈N₂O₅S

Purity: 98%

Color and Shape: Solid

Molecular weight: 468.5652

Ref: IN-DA00BF7G

Evatanepag

CAS: 223488-57-1

2-(3-((N-(4-(tert-Butyl)benzyl)pyridine-3-sulfonamido)methyl)phenoxy)acetic acid

Formula: C₂₅H₂₈N₂O₅S

Purity: 98%

Molecular weight: 468.57

Ref: IN-DG630562

2-[3-[N-(4-tert-Butylbenzyl)-N-(pyridin-3-ylsulfonyl)aminomethyl]phenoxy]acetic acid

CAS: 223488-57-1

2-[3-[N-(4-tert-Butylbenzyl)-N-(pyridin-3-ylsulfonyl)aminomethyl]phenoxy]acetic acid is a synthetic chemical compound, which is derived from organic synthesis processes involving aromatic compounds. It functions primarily through the modulation of specific biochemical pathways, likely involving interactions with enzymatic or receptor targets due to its structural characteristics. This compound is particularly noteworthy for its potential applications in biomedical research, where it may serve as a lead or active molecule in the development of new pharmaceutical agents. Its unique structure, featuring both aromatic and sulfonyl groups, allows for versatile interactions with biological targets, opening possibilities for its use in therapeutic development. Further research into its exact mechanisms and potential therapeutic uses could yield significant advancements in the treatment of various ailments.

Formula: C₂₅H₂₈N₂O₅S

Purity: Min. 98 Area-%

Color and Shape: Powder

Molecular weight: 468.57 g/mol

Ref: 3D-FT145127

EVATANEPAG

CAS: 223488-57-1

Purity: 98%

Molecular weight: 468.5700073

Ref: 10-F804925

Evatanepag

Controlled Product

CAS: 223488-57-1

Formula: C₂₅H₂₈N₂O₅S

Color and Shape: Neat

Molecular weight: 468.565

Ref: TR-E353360