CymitQuimica logo

CAS 223488-57-1

:

2-[3-[N-(4-tert-Butylbenzyl)-N-(pyridin-3-ylsulfonyl)aminomethyl]phenoxy]acetic acid

Description:
2-[3-[N-(4-tert-Butylbenzyl)-N-(pyridin-3-ylsulfonyl)aminomethyl]phenoxy]acetic acid, with CAS number 223488-57-1, is a synthetic organic compound characterized by its complex structure, which includes a phenoxyacetic acid moiety and a sulfonamide group. This compound typically exhibits properties associated with both acidic and basic functional groups, allowing it to participate in various chemical reactions. It is likely to be soluble in polar solvents due to the presence of the sulfonamide and carboxylic acid functionalities, while the tert-butyl group may enhance its lipophilicity. The compound may also exhibit biological activity, potentially acting as a pharmacological agent, given its structural features that resemble those of known drug candidates. Its synthesis involves multiple steps, including the formation of the sulfonamide and the coupling of the phenoxyacetic acid. As with many complex organic compounds, its stability, reactivity, and potential applications would depend on specific conditions such as pH, temperature, and the presence of other reagents.
Formula:C25H28N2O5S
InChI:InChI=1S/C25H28N2O5S/c1-25(2,3)21-11-9-19(10-12-21)16-27(33(30,31)23-8-5-13-26-15-23)17-20-6-4-7-22(14-20)32-18-24(28)29/h4-15H,16-18H2,1-3H3,(H,28,29)
InChI key:WOHRHWDYFNWPNG-UHFFFAOYSA-N
SMILES:CC(C)(C)C1=CC=C(C=C1)CN(CC2=CC(=CC=C2)OCC(=O)O)S(=O)(=O)C3=CN=CC=C3
Synonyms:
  • Cp-533536
Found 8 products.