
CAS 223488-57-1
:2-[3-[N-(4-tert-Butylbenzyl)-N-(pyridin-3-ylsulfonyl)aminomethyl]phenoxy]acetic acid
Description:
2-[3-[N-(4-tert-Butylbenzyl)-N-(pyridin-3-ylsulfonyl)aminomethyl]phenoxy]acetic acid, with CAS number 223488-57-1, is a synthetic organic compound characterized by its complex structure, which includes a phenoxyacetic acid moiety and a sulfonamide group. This compound typically exhibits properties associated with both acidic and basic functional groups, allowing it to participate in various chemical reactions. It is likely to be soluble in polar solvents due to the presence of the sulfonamide and carboxylic acid functionalities, while the tert-butyl group may enhance its lipophilicity. The compound may also exhibit biological activity, potentially acting as a pharmacological agent, given its structural features that resemble those of known drug candidates. Its synthesis involves multiple steps, including the formation of the sulfonamide and the coupling of the phenoxyacetic acid. As with many complex organic compounds, its stability, reactivity, and potential applications would depend on specific conditions such as pH, temperature, and the presence of other reagents.
Formula:C25H28N2O5S
InChI:InChI=1S/C25H28N2O5S/c1-25(2,3)21-11-9-19(10-12-21)16-27(33(30,31)23-8-5-13-26-15-23)17-20-6-4-7-22(14-20)32-18-24(28)29/h4-15H,16-18H2,1-3H3,(H,28,29)
InChI key:WOHRHWDYFNWPNG-UHFFFAOYSA-N
SMILES:CC(C)(C)C1=CC=C(C=C1)CN(CC2=CC(=CC=C2)OCC(=O)O)S(=O)(=O)C3=CN=CC=C3
Synonyms:- Cp-533536
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Evatanepag
CAS:Evatanepag (CP-533536) is a selective EP2 agonist for bone formation with 0.3 nM EC50, promoting fracture healing in rats.Formula:C25H28N2O5SPurity:97.09%Color and Shape:SolidMolecular weight:468.565Ref: TM-T15259
1mg66.00€5mg152.00€1mL*10mM (DMSO)158.00€10mg236.00€25mg409.00€50mg587.00€100mg802.00€2-(3-((N-(4-(Tert-Butyl)Benzyl)Pyridine-3-Sulfonamido)Methyl)Phenoxy)Acetic Acid
CAS:2-(3-((N-(4-(Tert-Butyl)Benzyl)Pyridine-3-Sulfonamido)Methyl)Phenoxy)Acetic AcidFormula:C25H28N2O5SPurity:98%Molecular weight:468.572-(3-((N-(4-(Tert-Butyl)Benzyl)Pyridine-3-Sulfonamido)Methyl)Phenoxy)Acetic Acid
CAS:Formula:C25H28N2O5SPurity:98%Color and Shape:SolidMolecular weight:468.5652Evatanepag
CAS:2-(3-((N-(4-(tert-Butyl)benzyl)pyridine-3-sulfonamido)methyl)phenoxy)acetic acidFormula:C25H28N2O5SPurity:98%Molecular weight:468.572-[3-[N-(4-tert-Butylbenzyl)-N-(pyridin-3-ylsulfonyl)aminomethyl]phenoxy]acetic acid
CAS:2-[3-[N-(4-tert-Butylbenzyl)-N-(pyridin-3-ylsulfonyl)aminomethyl]phenoxy]acetic acid is a synthetic chemical compound, which is derived from organic synthesis processes involving aromatic compounds. It functions primarily through the modulation of specific biochemical pathways, likely involving interactions with enzymatic or receptor targets due to its structural characteristics. This compound is particularly noteworthy for its potential applications in biomedical research, where it may serve as a lead or active molecule in the development of new pharmaceutical agents. Its unique structure, featuring both aromatic and sulfonyl groups, allows for versatile interactions with biological targets, opening possibilities for its use in therapeutic development. Further research into its exact mechanisms and potential therapeutic uses could yield significant advancements in the treatment of various ailments.Formula:C25H28N2O5SPurity:Min. 98 Area-%Color and Shape:PowderMolecular weight:468.57 g/mol






