CAS 22353-35-1

3-chloro-5-nitro-pyridin-2-amine

Description:

3-Chloro-5-nitro-pyridin-2-amine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a chlorine atom at the 3-position and a nitro group at the 5-position, along with an amino group at the 2-position, contributes to its unique chemical properties. This compound is typically a solid at room temperature and is soluble in polar solvents due to the presence of the amino group, which can engage in hydrogen bonding. It exhibits both basic and acidic properties, making it a versatile intermediate in organic synthesis. The nitro group is known for its electron-withdrawing effects, which can influence the reactivity of the compound in various chemical reactions, including nucleophilic substitutions and reductions. Additionally, 3-chloro-5-nitro-pyridin-2-amine may have applications in pharmaceuticals, agrochemicals, or as a building block in the synthesis of more complex molecules. Safety precautions should be taken when handling this compound, as it may pose health risks.

Formula: C₅H₄ClN₃O₂

InChI: InChI=1/C5H4ClN3O2/c6-4-1-3(9(10)11)2-8-5(4)7/h1-2H,(H2,7,8)

SMILES: c1c(cnc(c1Cl)N)N(=O)=O

Synonyms:

• 2-Amino-3-chloro-5-nitropyridine
• 2-Pyridinamine, 3-Chloro-5-Nitro-
• 3-Chloro-5-nitropyridin-2-amine

2-Amino-3-chloro-5-nitropyridine

CAS: 22353-35-1

2-Amino-3-chloro-5-nitropyridine

Formula: C₅H₄ClN₃O₂

Purity: 97%

Molecular weight: 173.56

Ref: IN-DG19482

2-Amino-3-chloro-5-nitropyridine

CAS: 22353-35-1

Formula: C₅H₄ClN₃O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 173.5572

Ref: IN-DA007OPM

2-Amino-3-chloro-5-nitropyridine

CAS: 22353-35-1

2-Amino-3-chloro-5-nitropyridine

Formula: C₅H₄ClN₃O₂

Purity: 99%

Molecular weight: 173.55716

Ref: 54-OR345299

2-Amino-3-chloro-5-nitropyridine

CAS: 22353-35-1

Formula: C₅H₄ClN₃O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 173.56

Ref: 10-F078309