CymitQuimica logo

CAS 223595-20-8

:

(R)-5-(1,3,6,2-Dioxazaborocan-2-yl)-1-methyl-2-tritylisoindoline

Description:
(R)-5-(1,3,6,2-Dioxazaborocan-2-yl)-1-methyl-2-tritylisoindoline, with CAS number 223595-20-8, is a complex organic compound characterized by its unique structural features, including a dioxazaborocane moiety and an isoindoline framework. This compound typically exhibits chirality due to the presence of the (R) configuration, which can influence its reactivity and interactions in various chemical environments. The dioxazaborocane component suggests potential applications in coordination chemistry and materials science, particularly in the development of boron-containing compounds. The trityl group enhances the stability and solubility of the molecule, making it suitable for various synthetic applications. Additionally, the isoindoline structure may impart interesting electronic properties, which could be leveraged in organic electronics or photonic devices. Overall, this compound represents a fascinating intersection of organic synthesis, coordination chemistry, and potential applications in advanced materials. Further studies would be necessary to explore its reactivity, stability, and potential applications in greater detail.
Formula:C32H33BN2O2
InChI:InChI=1/C32H33BN2O2/c1-25-31-18-17-30(33-36-21-19-34-20-22-37-33)23-26(31)24-35(25)32(27-11-5-2-6-12-27,28-13-7-3-8-14-28)29-15-9-4-10-16-29/h2-18,23,25,34H,19-22,24H2,1H3/t25-/m1/s1
InChI key:RQCOQFKQRXOKEP-RUZDIDTESA-N
SMILES:C[C@@H]1c2ccc(cc2CN1C(c1ccccc1)(c1ccccc1)c1ccccc1)B1OCCNCCO1
Synonyms:
  • (1R)-2,3-Dihydro-1-methyl-5-(tetrahydro-4H-1,3,6,2-dioxazaborocin-2-yl)-2-(triphenylmethyl)-1H-isoindole
  • 2-((1R)-1-Methyl-2-trityl-2,3-dihydro-1H-isoindol-5-yl)-1,3,6,2-dioxazaborocane
  • (1R)-5-(1,3,6,2-dioxazaborocan-2-yl)-1-methyl-2-trityl-2,3-dihydro-1H-isoindole
  • (R)-2-(1-methyl-2-tritylisoindolin-5-yl)-1,3,6,2-dioxazaborocane
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.