CAS 2236-52-4

2,2'-Diiodobiphenyl

Description:

2,2'-Diiodobiphenyl is an organic compound characterized by the presence of two iodine atoms attached to a biphenyl structure, specifically at the 2-position of each phenyl ring. This compound is typically a solid at room temperature and exhibits a crystalline appearance. It is relatively insoluble in water but soluble in organic solvents such as acetone and chloroform. The presence of iodine atoms significantly influences its chemical properties, including its reactivity and potential applications in various fields, such as organic synthesis and materials science. 2,2'-Diiodobiphenyl can participate in electrophilic substitution reactions due to the electron-withdrawing nature of the iodine substituents. Additionally, it may exhibit interesting electronic and optical properties, making it a candidate for use in organic electronics and photonic devices. Safety precautions should be taken when handling this compound, as iodine-containing substances can pose health risks. Overall, 2,2'-Diiodobiphenyl serves as a valuable compound in both research and industrial applications.

Formula: C₁₂H₈I₂

InChI: InChI=1/C12H8I2/c13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)14/h1-8H

SMILES: c1ccc(c(c1)c1ccccc1I)I

2,2'-Diiodobiphenyl

CAS: 2236-52-4

Formula: C₁₂H₈I₂

Purity: >98.0%(GC)

Color and Shape: White to Almost white powder to crystal

Molecular weight: 406.00

Ref: 3B-D2745

2,2-Diiodobiphenyl

CAS: 2236-52-4

Formula: C₁₂H₈I₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 406.0009

Ref: IN-DA003FB2

2,2’-Diiodo-1,1’-Biphenyl

CAS: 2236-52-4

2,2’-Diiodo-1,1’-Biphenyl

Purity: 98%

Molecular weight: 406.00g/mol

Ref: 54-OR1009916

2,2'-Diiodobiphenyl

CAS: 2236-52-4

2,2'-Diiodobiphenyl is a preparative reagent that can be used to prepare diazonium salts. It is prepared by reacting an alkynyl group with an activatable probe. The product of this reaction has the same reactivity as the parent compound, but with a different spatial orientation and chemical properties. The 2,2'-diiodophenyl can be used for the preparation of carbazoles and transfer reactions. The following are some examples of 2,2'-diiodophenyl compounds:
-Ethane-1,1'-dibromo-2,2'-diiodobiphenyl
-Carbazole-4-carboxaldehyde
-Naphthalene-1,5-dicarboxaldehyde

Formula: C₁₂H₈I₂

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 406 g/mol

Ref: 3D-FD69881