CAS 2236-52-4
:2,2'-Diiodobiphenyl
Description:
2,2'-Diiodobiphenyl is an organic compound characterized by the presence of two iodine atoms attached to a biphenyl structure, specifically at the 2-position of each phenyl ring. This compound is typically a solid at room temperature and exhibits a crystalline appearance. It is relatively insoluble in water but soluble in organic solvents such as acetone and chloroform. The presence of iodine atoms significantly influences its chemical properties, including its reactivity and potential applications in various fields, such as organic synthesis and materials science. 2,2'-Diiodobiphenyl can participate in electrophilic substitution reactions due to the electron-withdrawing nature of the iodine substituents. Additionally, it may exhibit interesting electronic and optical properties, making it a candidate for use in organic electronics and photonic devices. Safety precautions should be taken when handling this compound, as iodine-containing substances can pose health risks. Overall, 2,2'-Diiodobiphenyl serves as a valuable compound in both research and industrial applications.
Formula:C12H8I2
InChI:InChI=1/C12H8I2/c13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)14/h1-8H
SMILES:c1ccc(c(c1)c1ccccc1I)I
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2,2'-Diiodobiphenyl
CAS:Formula:C12H8I2Purity:>98.0%(GC)Color and Shape:White to Almost white powder to crystalMolecular weight:406.002,2'-Diiodo-1,1'-Biphenyl
CAS:2,2'-Diiodo-1,1'-BiphenylFormula:C12H8I2Purity:98%Molecular weight:406.02,2'-Diiodobiphenyl
CAS:2,2'-Diiodobiphenyl is a preparative reagent that can be used to prepare diazonium salts. It is prepared by reacting an alkynyl group with an activatable probe. The product of this reaction has the same reactivity as the parent compound, but with a different spatial orientation and chemical properties. The 2,2'-diiodophenyl can be used for the preparation of carbazoles and transfer reactions. The following are some examples of 2,2'-diiodophenyl compounds: -Ethane-1,1'-dibromo-2,2'-diiodobiphenyl -Carbazole-4-carboxaldehyde -Naphthalene-1,5-dicarboxaldehydeFormula:C12H8I2Purity:Min. 95%Color and Shape:PowderMolecular weight:406 g/molRef: 10-F827644
Discontinued product




