CAS 2237267-86-4

NAMPT activator-6

Description:

NAMPT activator-6, identified by its CAS number 2237267-86-4, is a chemical compound that serves as an activator of nicotinamide adenine dinucleotide (NAD+) biosynthesis through the stimulation of nicotinamide phosphoribosyltransferase (NAMPT). This compound is of interest in biochemical research, particularly in studies related to metabolism, aging, and cellular energy homeostasis. NAMPT plays a crucial role in the salvage pathway of NAD+ synthesis, which is vital for various cellular processes, including DNA repair, cell signaling, and energy metabolism. The activation of NAMPT can enhance NAD+ levels, potentially influencing cellular functions and promoting healthspan. While specific physical and chemical properties such as solubility, melting point, and stability may vary, the compound is typically characterized by its ability to modulate metabolic pathways and its potential therapeutic implications in age-related diseases and metabolic disorders. Further research is ongoing to fully elucidate its mechanisms of action and potential applications in pharmacology and biochemistry.

Formula: C₁₇H₂₁N₅O₃S

InChI: InChI=1S/C17H21N5O3S/c23-17(20-13-14-5-7-18-8-6-14)21-15-1-3-16(4-2-15)26(24,25)22-11-9-19-10-12-22/h1-8,19H,9-13H2,(H2,20,21,23)

InChI key: UJLNVXGRVQYDKI-UHFFFAOYSA-N

SMILES: C1CN(CCN1)S(=O)(=O)C2=CC=C(C=C2)NC(=O)NCC3=CC=NC=C3

Synonyms:

• NAMPT activator-6

NAMPT activator-6

CAS: 2237267-86-4

NAMPT activator-6 regulates NAMPT/NAD⁺ optogenetic systems, used to construct PS-PROTACs for light-dependent reversible regulation and reduced toxicity.

Formula: C₁₇H₂₁N₅O₃S

Purity: 97.02%

Color and Shape: Solid

Molecular weight: 375.45

Ref: TM-T86958