CymitQuimica logo

CAS 223734-62-1

:

(S)-5-[(Tetrahydropyranyl)oxy]-1-decyne

Description:
(S)-5-[(Tetrahydropyranyl)oxy]-1-decyne, with the CAS number 223734-62-1, is an organic compound characterized by its alkyne functional group and a tetrahydropyranyl ether moiety. This compound features a long carbon chain, specifically a decyne structure, which includes a triple bond between carbon atoms, contributing to its reactivity and potential applications in organic synthesis. The presence of the tetrahydropyranyl group indicates that the compound is likely to exhibit protective characteristics for hydroxyl groups, making it useful in various chemical reactions where selective reactivity is desired. The stereochemistry of the molecule is specified as (S), indicating the spatial arrangement of its atoms, which can influence its biological activity and interaction with other molecules. Overall, this compound may serve as an intermediate in the synthesis of more complex organic molecules or as a building block in materials science and medicinal chemistry. Its unique structure and functional groups provide opportunities for further exploration in chemical research and application.
Formula:C15H26O2
InChI:InChI=1S/C15H26O2/c1-3-5-7-11-14(10-6-4-2)17-15-12-8-9-13-16-15/h2,14-15H,3,5-13H2,1H3/t14-,15?/m1/s1
InChI key:RXFVLXNCIATBOG-GICMACPYSA-N
SMILES:CCCCC[C@@H](CCC#C)OC1CCCCO1
Found 4 products.