CymitQuimica logo

CAS 223777-16-0

:

2′-O-(2-Methoxyethyl)cytidine

Description:
2′-O-(2-Methoxyethyl)cytidine is a modified nucleoside that features a cytidine base with a 2-methoxyethyl group attached to the 2′ position of the ribose sugar. This modification enhances the stability and solubility of the nucleoside, making it particularly useful in various biochemical applications, including antiviral and therapeutic research. The presence of the methoxyethyl group can improve the compound's resistance to nucleases, thereby prolonging its biological activity. This nucleoside is often studied for its potential in RNA-based therapies and as a building block for oligonucleotide synthesis. Its unique structural characteristics contribute to its ability to interact with RNA and DNA, influencing hybridization properties and biological functions. Additionally, 2′-O-(2-Methoxyethyl)cytidine may exhibit altered pharmacokinetics compared to unmodified nucleosides, which can be advantageous in drug development. Overall, this compound represents a significant advancement in the field of nucleoside chemistry, with implications for therapeutic applications and molecular biology research.
Formula:C12H19N3O6
InChI:InChI=1S/C12H19N3O6/c1-19-4-5-20-10-9(17)7(6-16)21-11(10)15-3-2-8(13)14-12(15)18/h2-3,7,9-11,16-17H,4-6H2,1H3,(H2,13,14,18)/t7-,9-,10-,11-/m1/s1
InChI key:InChIKey=YKOGMMXZKKVMBT-QCNRFFRDSA-N
SMILES:O(CCOC)[C@H]1[C@@H](O[C@H](CO)[C@H]1O)N2C(=O)N=C(N)C=C2
Synonyms:
  • 2'-O-(2-methoxyethyl)-Cytidine
  • Cytidine, 2′-O-(2-methoxyethyl)-
Found 7 products.