CAS 22395-22-8
:7-methoxyflavanone
Description:
7-Methoxyflavanone is a flavonoid compound characterized by its flavanone structure, which consists of a chromone backbone with a methoxy group attached at the 7-position. This compound typically exhibits a pale yellow to light brown appearance and is soluble in organic solvents such as ethanol and methanol, but has limited solubility in water. 7-Methoxyflavanone is known for its potential biological activities, including antioxidant, anti-inflammatory, and antimicrobial properties, making it of interest in pharmacological research. Its structure allows for various interactions with biological molecules, which may contribute to its therapeutic effects. Additionally, it may play a role in plant defense mechanisms and has been studied for its potential health benefits in human nutrition. As with many flavonoids, it is believed to contribute to the health-promoting properties of fruits and vegetables in the diet. Safety and toxicity profiles should be considered in any application or study involving this compound.
Formula:C16H14O3
InChI:InChI=1/C16H14O3/c1-18-12-7-8-13-14(17)10-15(19-16(13)9-12)11-5-3-2-4-6-11/h2-9,15H,10H2,1H3
SMILES:COc1ccc2C(=O)CC(c3ccccc3)Oc2c1
Synonyms:- 7-Methoxyflavone
- 7-methoxy-2-phenyl-4H-chromen-4-one
- 7-methoxy-2-phenyl-2,3-dihydro-4H-chromen-4-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
4H-1-Benzopyran-4-one, 7-methoxy-2-phenyl-
CAS:Formula:C16H12O3Purity:98%Color and Shape:SolidMolecular weight:252.26477-Methoxyflavone
CAS:Formula:C16H12O3Purity:>98.0%(GC)Color and Shape:White to Light yellow powder to crystalMolecular weight:252.277-Methoxyflavone
CAS:7-Methoxyflavone isolated from Zornia brasiliensis with antinociceptive effects.Formula:C16H12O3Purity:99.36%Color and Shape:SolidMolecular weight:252.267-Methoxyflavone
CAS:7-Methoxyflavone is a bioactive compound classified as a flavonoid, which is derived from various natural sources such as plants, fruits, and vegetables. This compound exerts its biological effects through modulation of enzyme activity and interaction with cellular signaling pathways, primarily involving the modulation of cytochrome P450 enzymes and affecting neurotransmitter systems.Formula:C16H12O3Purity:Min. 95%Color and Shape:White PowderMolecular weight:252.26 g/mol7-Methoxy-2-phenyl-4H-chromen-4-one
CAS:Formula:C16H12O3Purity:98%Color and Shape:SolidMolecular weight:252.269





