CAS 224-42-0: Dibenz[a,j]acridine
Description:Dibenz[a,j]acridine is a polycyclic aromatic hydrocarbon (PAH) characterized by its complex fused ring structure, which consists of multiple aromatic rings. It is known for its planar geometry, which contributes to its stability and potential for intercalation into DNA. This compound is typically insoluble in water but soluble in organic solvents, reflecting its hydrophobic nature. Dibenz[a,j]acridine is of interest in various fields, including materials science and environmental chemistry, due to its potential mutagenic and carcinogenic properties, which are common among PAHs. Its synthesis often involves high-temperature processes or the pyrolysis of organic materials. Additionally, dibenz[a,j]acridine can be found in certain environmental samples, particularly in areas affected by combustion processes. Safety precautions are essential when handling this compound, as it may pose health risks upon exposure. Overall, dibenz[a,j]acridine serves as a significant subject of study in understanding the behavior and effects of polycyclic aromatic hydrocarbons in both biological and environmental contexts.
Formula:C21H13N
InChI:InChI=1S/C21H13N/c1-3-7-16-14(5-1)9-11-20-18(16)13-19-17-8-4-2-6-15(17)10-12-21(19)22-20/h1-13H
InChI key:InChIKey=ANUCHZVCBDOPOX-UHFFFAOYSA-N
SMILES:N=1C=2C=CC=3C=CC=CC3C2C=C4C1C=CC5=CC=CC=C54
- Synonyms:
- 1,2:7,8-Dibenzacridine
- 7-Azadibenz[a,j]anthracene
- Dibenz[A,J]Acridine
- NSC 114903
- Dibenzo[a,j]acridine

EPA Method 610 Additions PAH Mixture 445 5-100 µg/mL in Acetonitrile
Ref: 04-A50000445AL
1ml | To inquire |

EPA Method 610 Additions PAH Mixture 446 1000 µg/mL in Dichloromethane
Controlled ProductRef: 04-A50000446DI
1ml | 233.00 € |

EPA Method 8270 Appendix IX Mixture 2 1000 µg/mL in Dichloromethane
Controlled ProductRef: 04-GA09000445DI
1ml | 92.00 € |

Dibenz[a,j]acridine
Controlled ProductRef: 04-C20694600
10mg | 212.00 € |

Dibenz[a,j]acridine
Controlled ProductRef: TR-D416910
10mg | 232.00 € | ||
25mg | 349.00 € | ||
100mg | 1,064.00 € |

Dibenz[a,j]acridine
Ref: 3D-FD21521
5mg | Discontinued | Request information | |
10mg | Discontinued | Request information | |
25mg | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information |