CAS 2241501-10-8

2-Azabicyclo[2.2.1]heptane-5-carboxylic acid, methyl ester, hydrochloride (1:1)

Description:

2-Azabicyclo[2.2.1]heptane-5-carboxylic acid, methyl ester, hydrochloride (1:1) is a bicyclic compound characterized by its unique azabicyclic structure, which includes a nitrogen atom within a seven-membered ring. This compound features a carboxylic acid functional group that is esterified with a methyl group, enhancing its solubility and reactivity. The hydrochloride salt form indicates that the compound is protonated, which typically increases its stability and solubility in aqueous environments. This substance may exhibit properties such as being a potential intermediate in organic synthesis or a pharmacologically active compound, given the presence of the nitrogen atom that can participate in various chemical interactions. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of drugs targeting the central nervous system. The compound's characteristics, including its melting point, solubility, and reactivity, would be influenced by the presence of the hydrochloride group and the bicyclic framework, making it a subject of interest in both synthetic and medicinal chemistry research.

Formula: C₈H₁₃NO₂·ClH

InChI: InChI=1S/C8H13NO2.ClH/c1-11-8(10)7-3-6-2-5(7)4-9-6;/h5-7,9H,2-4H2,1H3;1H

InChI key: InChIKey=HWXFAQPPPXBKCZ-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1C2CC(C1)NC2.Cl

Synonyms:

• 2-Azabicyclo[2.2.1]heptane-5-carboxylic acid, methyl ester, hydrochloride (1:1)

2-Azabicyclo[2.2.1]heptane-5-carboxylic acid, methyl ester, hydrochloride (1:1)

CAS: 2241501-10-8

2-Azabicyclo[2.2.1]heptane-5-carboxylic acid, methyl ester, hydrochloride (1:1)

Formula: C₈H₁₄ClNO₂

Purity: 97%

Molecular weight: 191.66

Ref: 54-OR1118439

Methyl 2-azabicyclo[2.2.1]heptane-5-carboxylate hydrochloride

CAS: 2241501-10-8

Purity: 98%

Molecular weight: 191.6600037

Ref: 10-F619734