CAS 22428-87-1
:1,4-Dioxaspiro(4.5)decan-8-ol
Description:
1,4-Dioxaspiro(4.5)decan-8-ol is a chemical compound characterized by its unique spirocyclic structure, which features a dioxane ring fused to a decane framework. This compound contains two ether oxygen atoms within the dioxane moiety and a hydroxyl group (-OH) at the 8-position of the decane chain, contributing to its potential reactivity and solubility properties. The presence of the hydroxyl group suggests that it may exhibit hydrogen bonding capabilities, influencing its physical properties such as boiling point and solubility in polar solvents. Additionally, the spirocyclic nature of the compound can impart rigidity to its molecular structure, which may affect its conformational behavior and interactions with other molecules. 1,4-Dioxaspiro(4.5)decan-8-ol may find applications in organic synthesis, medicinal chemistry, or materials science, although specific applications would depend on further research into its biological activity and chemical reactivity. As with any chemical substance, proper handling and safety precautions should be observed due to potential hazards associated with its use.
Formula:C8H14O3
InChI:InChI=1/C8H14O3/c9-7-1-3-8(4-2-7)10-5-6-11-8/h7,9H,1-6H2
SMILES:C1CC2(CCC1O)OCCO2
Synonyms:- 4-Dioxaspiro[4.5]decan-8-ol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
4-Hydroxycyclohexanone ethylene acetal, 90+%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciPurity:90+%Color and Shape:Clear colorless to yellow, Liquid or viscous liquid1,4-Dioxaspiro[4.5]decan-8-ol
CAS:1,4-Dioxaspiro[4.5]decan-8-olFormula:C8H14O3Purity:98%Molecular weight:158.21,4-Dioxa-Spiro[4.5]Decan-8-ol
CAS:Formula:C8H14O3Purity:98%Color and Shape:LiquidMolecular weight:158.1950Ref: IN-DA00BDSA
1g22.00€5g30.00€10g34.00€25g54.00€50g73.00€100g128.00€250g173.00€500g322.00€1kg514.00€5kg2,036.00€10kg4,043.00€25kg9,926.00€1,4-Dioxaspiro[4.5]decan-8-ol
CAS:Formula:C8H14O3Purity:>98.0%(GC)Color and Shape:Colorless to Light yellow clear liquidMolecular weight:158.204-Hydroxycyclohexan-1-one monoethylene ketal
CAS:4-Hydroxycyclohexan-1-one monoethylene ketalFormula:C8H14O3Purity:98%Color and Shape:LiquidMolecular weight:158.194954-Hydroxycyclohexanone monoethylene ketal
CAS:Formula:C8H14O3Purity:98%Color and Shape:ClearMolecular weight:158.197





