CAS 224311-51-7
:2-(Di-tert-butylphosphino)biphenyl
Description:
2-(Di-tert-butylphosphino)biphenyl is a chemical compound characterized by its unique structure, which features a biphenyl backbone substituted with a di-tert-butylphosphino group. This compound is notable for its role as a ligand in various catalytic processes, particularly in transition metal catalysis. The presence of the bulky tert-butyl groups enhances steric hindrance, which can influence the reactivity and selectivity of metal complexes formed with this ligand. Additionally, the phosphino group contributes to the electronic properties of the compound, making it a valuable component in organometallic chemistry. The compound is typically stable under ambient conditions but may require careful handling due to the presence of phosphorus, which can be reactive under certain conditions. Its applications extend to fields such as organic synthesis and materials science, where it can facilitate various chemical transformations. Overall, 2-(Di-tert-butylphosphino)biphenyl exemplifies the intersection of sterics and electronics in ligand design for catalysis.
Formula:C20H27P
InChI:InChI=1S/C20H27P/c1-19(2,3)21(20(4,5)6)18-15-11-10-14-17(18)16-12-8-7-9-13-16/h7-15H,1-6H3
InChI key:InChIKey=CNXMDTWQWLGCPE-UHFFFAOYSA-N
SMILES:P(C(C)(C)C)(C(C)(C)C)C1=C(C=CC=C1)C2=CC=CC=C2
Synonyms:- (2-Biphenylyl)di-tert-butylphosphine
- (Biphenyl-2-yl)bis(tert-butyl)phosphine
- ([1,1′-Biphenyl]-2-yl)di(tert-butyl)phosphine
- 2-(Di-t-butylphosphino)biphenyl
- 2-(Di-tert-butylphosphino)-1,1′-biphenyl
- Biphenyl-2-Yl(Di-Tert-Butyl)Phosphane
- Di(tert-butyl)(1,1′-biphenyl-2-yl)phosphine
- Di(tert-butyl)(2-phenylphenyl)phosphine
- Di-tert-butyl-o-biphenylphosphine
- Dibutylphosphinobiphenyl
- JohnPhos
- Phosphine, [1,1′-biphenyl]-2-ylbis(1,1-dimethylethyl)-
- [1,1′-Biphenyl]-2-ylbis(1,1-dimethylethyl)phosphine
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
2-(Di-tert-butylphosphino)biphenyl
CAS:Formula:C20H27PPurity:>98.0%(GC)Color and Shape:White to Almost white powder to crystalMolecular weight:298.412-(Di-tert-butylphosphino)biphenyl
CAS:Formula:C20H27PPurity:98%Color and Shape:SolidMolecular weight:298.4021Ref: IN-DA0032VJ
500gTo inquire1g34.00€5g35.00€10g57.00€25g88.00€50g134.00€100g184.00€250g569.00€1kg810.00€5kg4,285.00€2-[Bis(tert-butyl)phosphino]biphenyl
CAS:2-[Bis(tert-butyl)phosphino]biphenylFormula:C20H27PPurity:97%Color and Shape:White Solid-PowderMolecular weight:298.402142-(Di-tert-butylphosphino)biphenyl
CAS:Controlled ProductFormula:C20H27PColor and Shape:NeatMolecular weight:298.4Biphenyl-2-yl-di-tert-butyl-phosphane
CAS:Formula:C20H27PPurity:98%Color and Shape:SolidMolecular weight:298.412-(Di-t-butylphosphino))-1,1'-biphenyl, 99% JohnPhos
CAS:2-(Di-t-butylphosphino))-1,1'-biphenyl, 99% JohnPhos
Formula:C20H27PPurity:99%Color and Shape:white xtl.Molecular weight:298.41(2-Biphenyl)di-tert-butylphosphine
CAS:2-Biphenyl)di-tert-butylphosphine is a synthetic small molecule that binds to receptors in the body, and has been shown to inhibit cancer cell growth. It also prevents kidney fibrosis by inhibiting production of growth factors such as PDGF and IGF. 2-Biphenyl)di-tert-butylphosphine has shown anti-diabetic effects, which may be due to its ability to activate GLP-1R agonists and inhibit pyrimidine synthesis. This drug has been found to have structural similarities with quinoline derivatives and other nitrogen containing compounds, which may provide insight into its binding mechanism. 2-Biphenyl)di-tert-butylphosphine was synthesized in the reaction between triphenyl phosphite and biphenylene, followed by treatment with tert butanol. The X ray crystal structures of this drug bound to human serum albumin show that the carboxyFormula:C20H27PPurity:Min. 95%Color and Shape:White PowderMolecular weight:298.4 g/mol







