CymitQuimica logo

CAS 22439-48-1

:

2-Dibenzofurancarboxylic acid

Description:
2-Dibenzofurancarboxylic acid is an organic compound characterized by its dibenzofuran structure, which consists of a fused ring system featuring both benzene and furan moieties. This compound typically appears as a white to off-white solid and is known for its aromatic properties, contributing to its stability and potential applications in organic synthesis. It possesses a carboxylic acid functional group, which imparts acidic characteristics and allows for various chemical reactions, such as esterification and amidation. The presence of the dibenzofuran framework may also enhance its biological activity, making it of interest in pharmaceutical research. Additionally, 2-dibenzofurancarboxylic acid is soluble in organic solvents, which facilitates its use in various chemical processes. Its unique structure and functional groups make it a valuable compound in the development of new materials and in the study of chemical reactivity and interactions. As with many organic compounds, safety precautions should be observed when handling this substance, as it may pose health risks if ingested or inhaled.
Formula:C13H8O3
InChI:InChI=1S/C13H8O3/c14-13(15)8-5-6-12-10(7-8)9-3-1-2-4-11(9)16-12/h1-7H,(H,14,15)
InChI key:UGKPZVGCVIWBNX-UHFFFAOYSA-N
SMILES:C1=CC=C2C(=C1)C3=C(O2)C=CC(=C3)C(=O)O
Found 4 products.