CAS 22468-26-4
:4-Hydroxypyridine-2-carboxylic acid
Description:
4-Hydroxypyridine-2-carboxylic acid, also known as 2-carboxy-4-hydroxypyridine, is an organic compound characterized by its pyridine ring structure, which features a hydroxyl group and a carboxylic acid group. This compound is typically a white to off-white crystalline solid that is soluble in water and polar organic solvents. It exhibits both acidic and basic properties due to the presence of the carboxylic acid and the nitrogen atom in the pyridine ring, allowing it to participate in various chemical reactions, including esterification and amidation. The compound is of interest in pharmaceutical and agricultural chemistry, often serving as an intermediate in the synthesis of biologically active molecules. Additionally, it may exhibit chelating properties, making it useful in coordination chemistry. Its molecular structure contributes to its reactivity and potential applications in various fields, including medicinal chemistry and materials science. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C6H5NO3
InChI:InChI=1/C6H5NO3/c8-4-1-2-7-5(3-4)6(9)10/h1-3H,(H,7,8)(H,9,10)
SMILES:c1c[nH]c(cc1=O)C(=O)O
Synonyms:- 4-Hydroxypicolinic acid
- 4-Oxo-1,4-Dihydropyridine-2-Carboxylic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
4-Hydroxy-2-pyridinecarboxylic Acid
CAS:Formula:C6H5NO3Purity:>98.0%(T)(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:139.114-Hydroxypyridine-2-carboxylic acid, 97%
CAS:It is an important raw material and intermediate used in organic synthesis, pharmaceuticals, agrochemicals and dyestuffs. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. ThFormula:C6H5NO3Purity:97%Color and Shape:White to cream, PowderMolecular weight:139.114-Hydroxypyridine-2-carboxylic acid
CAS:4-Hydroxypyridine-2-carboxylic acidFormula:C6H5NO3Purity:≥95%Color and Shape:Solid-PowderMolecular weight:139.10884-Hydroxypicolinic acid (contains <10% H2O)
CAS:Formula:C6H5NO3Purity:95%Color and Shape:White powderMolecular weight:139.114-Hydroxy-pyridine-2-carboxylic acid
CAS:4-Hydroxy-pyridine-2-carboxylic acid is an endogenous metabolite that is released from the degradation of 4-hydroxyphenylpyruvic acid. This chemical has shown to have potent antiinflammatory effects in vitro, inhibiting the release of histamine and leukotrienes. It also appears to be protective against cutaneous anaphylaxis and may serve as a potential therapeutic agent for allergic skin diseases.Purity:Min. 95%





