CymitQuimica logo

CAS 2247972-61-6

:

7-Benzoxazolecarboxylic acid, 5-[2-[2-chloro-4-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-4-isoxazolyl]methoxy]phenyl]ethynyl]-2-cyclopropyl-

Description:
7-Benzoxazolecarboxylic acid, 5-[2-[2-chloro-4-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-4-isoxazolyl]methoxy]phenyl]ethynyl]-2-cyclopropyl- is a complex organic compound characterized by its unique structural features, including a benzoxazole ring and multiple functional groups. The presence of the carboxylic acid group suggests it can participate in acid-base reactions and may exhibit solubility in polar solvents. The compound also contains a chloro substituent and a cyclopropyl group, which can influence its reactivity and steric properties. Additionally, the isoxazole moiety contributes to its potential biological activity, as such structures are often found in pharmacologically active compounds. The ethynyl linkage indicates the potential for further chemical modifications, making it a versatile scaffold for synthetic chemistry. Overall, this compound's intricate structure may confer specific properties that could be explored in medicinal chemistry or material science applications.
Formula:C32H21Cl3N2O5
InChI:InChI=1S/C32H21Cl3N2O5/c33-23-2-1-3-24(34)27(23)28-22(29(42-37-28)18-6-7-18)15-40-20-11-10-17(25(35)14-20)5-4-16-12-21(32(38)39)30-26(13-16)36-31(41-30)19-8-9-19/h1-3,10-14,18-19H,6-9,15H2,(H,38,39)
InChI key:AJAPXAHNLZNFGP-UHFFFAOYSA-N
SMILES:C1CC1C2=C(C(=NO2)C3=C(C=CC=C3Cl)Cl)COC4=CC(=C(C=C4)C#CC5=CC(=C6C(=C5)N=C(O6)C7CC7)C(=O)O)Cl
Synonyms:
  • 7-Benzoxazolecarboxylic acid, 5-[2-[2-chloro-4-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-4-isoxazolyl]methoxy]phenyl]ethynyl]-2-cyclopropyl-
  • Lecufexor
Found 1 products.