CymitQuimica logo

CAS 2250023-38-0

:

Ethyl 4-Bromo-5-chloro-1H-benzimidazole-2-carboxylate

Description:
Ethyl 4-Bromo-5-chloro-1H-benzimidazole-2-carboxylate is a chemical compound characterized by its complex structure, which includes a benzimidazole core substituted with bromine and chlorine atoms, as well as an ethyl ester functional group. This compound typically exhibits properties associated with heterocyclic compounds, such as moderate solubility in organic solvents and potential reactivity due to the presence of halogen substituents. The presence of the carboxylate group suggests it may participate in various chemical reactions, including esterification and nucleophilic substitutions. Additionally, the halogen atoms can influence the compound's electronic properties, potentially enhancing its biological activity or reactivity in synthetic pathways. Ethyl 4-Bromo-5-chloro-1H-benzimidazole-2-carboxylate may be of interest in medicinal chemistry and material science, given the significance of benzimidazole derivatives in pharmaceuticals and agrochemicals. As with any chemical substance, proper handling and safety precautions should be observed, particularly due to the presence of halogens, which can pose health and environmental risks.
Formula:C10H8BrClN2O2
InChI:InChI=1S/C10H8BrClN2O2/c1-2-16-10(15)9-13-6-4-3-5(12)7(11)8(6)14-9/h3-4H,2H2,1H3,(H,13,14)
InChI key:PPGXAMHHSYQKIP-UHFFFAOYSA-N
SMILES:CCOC(=O)C1=NC2=C(N1)C=CC(=C2Br)Cl
Synonyms:
  • 4-Bromo-5-chloro-1H-benzoimidazole-2-carboxylic acid ethyl ester
  • Ethyl 7-bromo-6-chloro-1H-benzo[d]imidazole-2-carboxylate
  • Ethyl 4-Bromo-5-chloro-1H-benzimidazole-2-carboxylate
  • 1H-Benzimidazole-2-carboxylic acid, 7-bromo-6-chloro-, ethyl ester
  • ethyl 7-bromo-6-chloro-1H-benzimidazole-2-carboxylate
Found 4 products.