CAS 22518-06-5

10-Isobutyryloxy-8,9-epoxythymol isobutyrate

Description:

10-Isobutyryloxy-8,9-epoxythymol isobutyrate, identified by its CAS number 22518-06-5, is a chemical compound that belongs to the class of esters. This substance features a complex structure characterized by the presence of an epoxide group, which contributes to its reactivity and potential applications in organic synthesis. The isobutyryloxy group enhances its solubility and stability, making it suitable for various chemical reactions. Typically, compounds like this may exhibit biological activity, potentially serving as intermediates in the synthesis of pharmaceuticals or agrochemicals. Its specific properties, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the presence of functional groups. Safety data sheets would provide essential information regarding handling, storage, and potential hazards associated with this compound. Overall, 10-Isobutyryloxy-8,9-epoxythymol isobutyrate represents a unique structure that may be of interest in both research and industrial applications.

Formula: C₁₈H₂₄O₅

InChI: InChI=1S/C18H24O5/c1-11(2)16(19)21-9-18(10-22-18)14-7-6-13(5)8-15(14)23-17(20)12(3)4/h6-8,11-12H,9-10H2,1-5H3

InChI key: InChIKey=OLARKEMZPWGFJU-UHFFFAOYSA-N

SMILES: C(OC(C(C)C)=O)C1(CO1)C2=C(OC(C(C)C)=O)C=C(C)C=C2

Synonyms:

• Propanoic acid, 2-methyl-, 5-methyl-2-[2-[(2-methyl-1-oxopropoxy)methyl]-2-oxiranyl]phenyl ester
• Propanoic acid, 2-methyl-, 5-methyl-2-[2-[(2-methyl-1-oxopropoxy)methyl]oxiranyl]phenyl ester
• 10-Isobutyryloxy-8,9-epoxythymol isobutyrate
• Isobutyric acid, diester with 2,3-epoxy-2-(2-hydroxy-p-tolyl)-1-propanol

8,9-epoxy-3,10-diisobutyryloxythymol

CAS: 22518-06-5

Formula: C₁₈H₂₄O₅

Molecular weight: 320.39

Ref: 7W-GY4713

10-​Isobutyryloxy-​8,​9-​epoxythymol isobutyrate

CAS: 22518-06-5

10-Isobutyryloxy-8,9-epoxythymol isobutyrate is a major constituent of Inula helenium and Inula royleana root cultures.

Formula: C₁₈H₂₄O₅

Purity: 98%

Color and Shape: Solid

Molecular weight: 320.38

Ref: TM-T10037

8,9-epoxy-3,10-diisobutyryloxythymol

CAS: 22518-06-5

Formula: C₁₈H₂₄O₅

Purity: 95%~99%

Molecular weight: 320.385

Ref: BP-BP4029

10-Isobutyryloxy-89-epoxythymyl isobutyrate

CAS: 22518-06-5

10-Isobutyryloxy-89-epoxythymyl isobutyrate is a bioactive compound, categorized as a naturally derived chemical. This compound is extracted from plant sources known for their therapeutic potential, specifically those related to the thymol family. The mode of action of 10-Isobutyryloxy-89-epoxythymyl isobutyrate primarily involves its interaction with microbial cell membranes, leading to disruption of cellular processes and ultimately microbial inhibition or death. Its structure suggests a potential for disrupting biofilms and inhibiting the growth of various pathogens, making it a promising candidate for antimicrobial applications.

Formula: C₁₈H₂₄O₅

Purity: Min. 95%

Molecular weight: 320.38 g/mol

Ref: 3D-XI172956