CAS 22551-24-2
:2-(methylsulfanyl)acetamide
Description:
2-(Methylsulfanyl)acetamide, with the CAS number 22551-24-2, is an organic compound characterized by the presence of a methylthio group (-S-CH3) attached to an acetamide moiety. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is soluble in polar solvents such as water and alcohols, owing to the presence of the amide functional group, which can engage in hydrogen bonding. The methylsulfanyl group contributes to its unique chemical reactivity, making it a potential candidate for various synthetic applications in organic chemistry. Additionally, 2-(methylsulfanyl)acetamide may exhibit biological activity, which could be of interest in pharmaceutical research. Its stability under standard conditions is generally good, although it may be sensitive to strong acids or bases. As with many organic compounds, proper handling and safety precautions should be observed due to potential toxicity or irritant properties.
Formula:C3H7NOS
InChI:InChI=1/C3H7NOS/c1-6-2-3(4)5/h2H2,1H3,(H2,4,5)
InChI key:OBENGAMZEGRSIC-UHFFFAOYSA-N
SMILES:CSCC(=N)O
Synonyms:- 2-(Methylsulfanyl)acetamid
- 2-(Methylthio)acetamide
- Acetamide, 2-(Methylthio)-
- 2-(Methylsulfanyl)acetamide
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
2-(Methylthio)acetamide
CAS:Formula:C3H7NOSPurity:>98.0%(GC)Color and Shape:White to Almost white powder to crystalMolecular weight:105.162-(Methylthio)acetamide
CAS:Methylthioacetic acid is a weak organic acid that is used as an ophthalmic drug. When methylthioacetic acid is activated, intramolecular hydrogen bonds form between the methylthiosulfonate ion and the nitrate ion. This process requires spin resonance to take place, which can be explained by the functional theory of kinetics. The reaction of methylthioacetic acid with nitrate ions to form methylthiosulfonate ions has been shown to be rapid and reversible in both dry weight and wet weight experiments. The alkylation of methylthioacetic acid with ethyl bromoacetate has been shown to produce thermochemically stable imine and phosphate ions.Formula:C3H7NOSPurity:Min. 95%Color and Shape:PowderMolecular weight:105.16 g/mol





