CymitQuimica logo

CAS 22610-18-0

:

2-phenylazetidine

Description:
2-Phenylazetidine is a cyclic amine characterized by a four-membered ring structure containing a nitrogen atom and a phenyl group attached to the second carbon of the azetidine ring. This compound exhibits properties typical of azetidines, such as being a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It has a relatively low boiling point and is soluble in organic solvents, which makes it useful in various chemical reactions and syntheses. The presence of the phenyl group contributes to its aromatic characteristics, potentially influencing its reactivity and interaction with other chemical species. 2-Phenylazetidine can participate in nucleophilic substitution reactions and may serve as a building block in the synthesis of more complex organic molecules, including pharmaceuticals and agrochemicals. Its unique structure allows for potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. As with many nitrogen-containing compounds, safety precautions should be taken when handling 2-phenylazetidine due to potential toxicity and reactivity.
Formula:C9H11N
InChI:InChI=1/C9H11N/c1-2-4-8(5-3-1)9-6-7-10-9/h1-5,9-10H,6-7H2
InChI key:CLNGGMJEJSANIE-UHFFFAOYSA-N
SMILES:c1ccc(cc1)C1CCN1
Synonyms:
  • Azetidine, 2-phenyl-
  • 2-Phenylazetidine ISO 9001:2015 REACH
  • 2-phenylazetidine(SALTDATA: FREE)
  • 2-Phenylazetidine
  • 2-Phenylazetidine HCl
Found 5 products.