CAS 22620-27-5
:5-Chloronicotinic acid
Description:
5-Chloronicotinic acid is a chemical compound that belongs to the class of heterocyclic aromatic compounds, specifically a chlorinated derivative of nicotinic acid. It features a pyridine ring with a carboxylic acid group and a chlorine atom positioned at the 5th carbon of the ring. This compound is typically a white to off-white crystalline solid and is soluble in polar solvents such as water and alcohols, owing to the presence of the carboxylic acid functional group. 5-Chloronicotinic acid is of interest in various fields, including medicinal chemistry and agrochemicals, due to its potential biological activities and applications in the synthesis of pharmaceuticals. It can act as a building block for the development of more complex molecules and is also studied for its role in various chemical reactions, including coupling reactions and as a ligand in coordination chemistry. Safety data indicates that, like many chlorinated compounds, it should be handled with care, as it may pose health risks if ingested or inhaled.
Formula:C6H4ClNO2
InChI:InChI=1/C6H4ClNO2/c7-5-1-4(6(9)10)2-8-3-5/h1-3H,(H,9,10)
SMILES:c1c(cncc1Cl)C(=O)O
Synonyms:- 5-Chloro-3-pyridinecarboxylicacid
- 5-Chloropyridine-3-carboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
5-Chloronicotinic Acid
CAS:Formula:C6H4ClNO2Purity:>95.0%(GC)(T)Color and Shape:White to Almost white powder to crystalMolecular weight:157.555-Chloronicotinic acid
CAS:5-Chloronicotinic acidFormula:C6H4ClNO2Purity:≥95%Color and Shape:Cream Solid-PowderMolecular weight:157.554463-Pyridinecarboxylic acid, 5-chloro-
CAS:Formula:C6H4ClNO2Purity:97%Color and Shape:SolidMolecular weight:157.55455-Chloronicotinic Acid
CAS:Controlled ProductApplications 5-Chloronicotinic Acid is used as reagent/reactant luminescence and hydrothermal preparation of cobalt/cadmium/lead chloronicotinate phenanthroline MOF.
References Gao, Z.Q., et al.: J. Solid State Chem., 241, 121-130 (2016)Formula:C6H4ClNO2Color and Shape:NeatMolecular weight:157.554





