CAS 2265-91-0
:1,3-Difluoro-5-iodobenzene
Description:
1,3-Difluoro-5-iodobenzene is an aromatic halogenated compound characterized by the presence of two fluorine atoms and one iodine atom attached to a benzene ring. The molecular formula for this compound is C6H3F2I, indicating that it contains six carbon atoms, three hydrogen atoms, two fluorine atoms, and one iodine atom. This compound typically exhibits a colorless to pale yellow appearance and is known for its relatively low volatility. The presence of electronegative halogens, such as fluorine and iodine, significantly influences its chemical reactivity, making it a useful intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. Its unique substitution pattern (with fluorine atoms at the 1 and 3 positions and iodine at the 5 position) can affect its electronic properties and steric hindrance, which are critical in determining its reactivity and interactions with other chemical species. Additionally, 1,3-difluoro-5-iodobenzene may exhibit specific solubility characteristics, often being soluble in organic solvents while having limited solubility in water.
Formula:C6H3F2I
InChI:InChI=1S/C6H3F2I/c7-4-1-5(8)3-6(9)2-4/h1-3H
InChI key:InChIKey=QQCFOQNFPIAENW-UHFFFAOYSA-N
SMILES:FC1=CC(F)=CC(I)=C1
Synonyms:- 1-Iodo-3,5-difluorobenzene
- 3,5-Difluoro iodobenzene
- 3,5-Difluoro-1-iodobenzene
- 3,5-Difluoroiodobenzene
- Benzene, 1,3-difluoro-5-iodo-
- 1,3-Difluoro-5-iodobenzene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
1,3-Difluoro-5-iodobenzene, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C6H3F2IPurity:98%Color and Shape:Clear colorless to yellow, LiquidMolecular weight:239.993,5-Difluoroiodobenzene
CAS:3,5-DifluoroiodobenzeneFormula:C6H3F2IPurity:98%Color and Shape:Colourless LiquidMolecular weight:239.98929Benzene, 1,3-difluoro-5-iodo-
CAS:Formula:C6H3F2IPurity:98%Color and Shape:LiquidMolecular weight:239.98931,3-Difluoro-5-iodobenzene
CAS:Formula:C6H3F2IPurity:>98.0%(GC)Color and Shape:Colorless to Light yellow to Light orange clear liquidMolecular weight:239.991,3-Difluoro-5-iodobenzene
CAS:1,3-Difluoro-5-iodobenzeneFormula:C6H3F2IPurity:98%Molecular weight:239.99





