CAS 2265-92-1
:1,4-Difluoro-2-iodobenzene
Description:
1,4-Difluoro-2-iodobenzene is an aromatic halogenated compound characterized by the presence of two fluorine atoms and one iodine atom attached to a benzene ring. The molecular formula for this compound is C6H3F2I, indicating a substitution pattern where the fluorine atoms are located at the para positions (1 and 4) and the iodine atom at the meta position (2) relative to each other on the benzene ring. This structure contributes to its unique chemical properties, including its reactivity and polarity. The presence of electronegative halogens influences the compound's physical properties, such as boiling and melting points, which are typically higher than those of non-halogenated benzene derivatives. 1,4-Difluoro-2-iodobenzene is often utilized in organic synthesis and as an intermediate in the production of pharmaceuticals and agrochemicals. Its reactivity can be attributed to the halogen substituents, which can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. Safety precautions should be observed when handling this compound due to its potential toxicity and environmental impact.
Formula:C6H3F2I
InChI:InChI=1/C6H3F2I/c7-4-1-2-5(8)6(9)3-4/h1-3H
SMILES:c1cc(c(cc1F)I)F
Synonyms:- 2,5-Difluoroiodobenzene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
1,4-Difluoro-2-iodobenzene
CAS:Formula:C6H3F2IPurity:>98.0%(GC)Color and Shape:Colorless to Light yellow to Light red clear liquidMolecular weight:239.991,4-Difluoro-2-iodobenzene, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C6H3F2IPurity:97%Color and Shape:Clear red, LiquidMolecular weight:239.992,5-Difluoroiodobenzene
CAS:2,5-DifluoroiodobenzeneFormula:C6H3F2IPurity:98%Color and Shape:Liquid-ClearMolecular weight:239.989291,4-difluoro-2-iodobenzene
CAS:Formula:C6H3F2IPurity:98%Color and Shape:LiquidMolecular weight:239.98931,4-Difluoro-2-iodobenzene, min. 98%
CAS:Formula:C6H3F2IPurity:min. 98%Color and Shape:Colorless to pale-yellow liquidMolecular weight:239.99






