CymitQuimica logo

CAS 227609-85-0

:

Benzonitrile,2-fluoro-5-(hydroxymethyl)-

Description:
Benzonitrile, 2-fluoro-5-(hydroxymethyl)-, is an organic compound characterized by the presence of a benzonitrile moiety with a fluorine atom and a hydroxymethyl group attached to the aromatic ring. The molecular structure features a cyano group (-C≡N) that contributes to its reactivity and potential applications in organic synthesis. The fluorine atom introduces unique electronic properties, which can influence the compound's polarity and reactivity. The hydroxymethyl group (-CH2OH) adds hydrophilicity, enhancing solubility in polar solvents and potentially participating in hydrogen bonding interactions. This compound may be utilized in various chemical reactions, including nucleophilic substitutions and as a building block in the synthesis of pharmaceuticals or agrochemicals. Its specific properties, such as boiling point, melting point, and solubility, would depend on the molecular interactions and the presence of functional groups. Safety data should be consulted for handling and storage, as compounds with nitrile groups can pose health risks. Overall, this compound exemplifies the complexity and utility of substituted benzonitriles in chemical research and applications.
Formula:C8H6FNO
InChI:InChI=1S/C8H6FNO/c9-8-2-1-6(5-11)3-7(8)4-10/h1-3,11H,5H2
InChI key:OOVBMNHJMJKTRH-UHFFFAOYSA-N
SMILES:C1=CC(=C(C=C1CO)C#N)F
Synonyms:
  • 2-Fluoro-5-(hydroxymethyl)benzonitrile
  • 3-Cyano-4-fluorobenzyl alcohol
  • 4-Fluoro-3-cyanobenzyl alcohol
Found 4 products.