CymitQuimica logo

CAS 2279-08-5

:

Z-D-Arg(NO2)-OH

Description:
Z-D-Arg(NO2)-OH, also known as Z-D-arginine nitro, is a derivative of the amino acid arginine, characterized by the presence of a nitro group (NO2) attached to the side chain of the arginine molecule. The "Z" prefix indicates that it is protected at the α-amino group, typically by a benzyloxycarbonyl (Z) group, which is commonly used in peptide synthesis to prevent unwanted reactions. This compound is often utilized in biochemical research and pharmaceutical applications, particularly in the study of nitric oxide synthase and related pathways due to its structural similarity to arginine, a substrate for nitric oxide production. Z-D-Arg(NO2)-OH is generally a white to off-white solid, soluble in polar solvents, and may exhibit specific biological activities related to its nitro group. As with many nitro compounds, it is essential to handle it with care due to potential reactivity and toxicity. Proper safety protocols should be followed when working with this substance in a laboratory setting.
Formula:C14HN5O6
InChI:InChI=1S/C14H19N5O6/c15-13(18-19(23)24)16-8-4-7-11(12(20)21)17-14(22)25-9-10-5-2-1-3-6-10/h1-3,5-6,11H,4,7-9H2,(H,17,22)(H,20,21)(H3,15,16,18)/t11-/m1/s1
InChI key:BZPCSFNCKORLQG-LLVKDONJSA-N
SMILES:C1=CC=C(C=C1)COC(=O)N[C@H](CCCN=C(N)N[N+](=O)[O-])C(=O)O
Found 2 products.