CymitQuimica logo

CAS 228410-90-0

:

5-bromo-4-methyl-3-nitropyridin-2(1H)-one

Description:
5-Bromo-4-methyl-3-nitropyridin-2(1H)-one is a heterocyclic organic compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a bromine atom at the 5-position, a methyl group at the 4-position, and a nitro group at the 3-position, along with a carbonyl group at the 2-position, contributing to its reactivity and potential applications in various chemical reactions. The presence of these functional groups imparts distinct chemical properties, such as increased electrophilicity due to the nitro group and potential for nucleophilic substitution reactions. It is typically used in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals. The compound's molecular structure allows for various interactions, making it a valuable intermediate in the synthesis of more complex molecules. Additionally, its solubility and stability can vary depending on the solvent and conditions, which are important considerations for its practical applications in laboratory settings.
Formula:C6H5BrN2O3
InChI:InChI=1/C6H5BrN2O3/c1-3-4(7)2-8-6(10)5(3)9(11)12/h2H,1H3,(H,8,10)
InChI key:QXPNHVCGSASGIX-UHFFFAOYSA-N
SMILES:Cc1c(cnc(c1N(=O)=O)O)Br
Synonyms:
  • 2-Pyridinol, 5-Bromo-4-Methyl-3-Nitro-
  • 5-Bromo-2-Hydroxy-4-Methyl-3-Nitropyridine
  • 5-Bromo-4-Methyl-3-Nitropyridin-2-Ol
Found 5 products.