CAS 22890-21-7
:IsostearicacidHeptylundecanoic acid); 95%
Description:
Isostearic acid, also known as heptylundecanoic acid, is a branched-chain fatty acid characterized by its unique structure that includes a long hydrocarbon chain with a branching point. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its specific formulation and temperature. It is known for its low viscosity and excellent lubricating properties, making it useful in various industrial applications, including cosmetics, personal care products, and as an additive in lubricants and greases. Isostearic acid is also valued for its emollient properties, providing a smooth feel and enhancing the texture of formulations. Its chemical stability and resistance to oxidation contribute to its effectiveness in formulations. Additionally, it is biodegradable, which aligns with increasing environmental concerns regarding chemical usage. The compound is generally considered safe for use in cosmetic applications, although it is always important to consider individual sensitivities and regulatory guidelines. Overall, isostearic acid serves as a versatile ingredient in both industrial and consumer products.
Formula:C18H36O2
InChI:InChI=1/C18H36O2/c1-3-5-7-9-10-12-14-16-17(18(19)20)15-13-11-8-6-4-2/h17H,3-16H2,1-2H3,(H,19,20)
SMILES:CCCCCCCCCC(CCCCCCC)C(=O)O
Synonyms:- Isostearic acid (=2n-Heptylundecanoic acid)
- 2-Heptylundecanoic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
2-heptylundecanoic acid
CAS:2-heptylundecanoic acidFormula:C18H36O2Purity:≥98%Molecular weight:284.482-Heptylundecanoic Acid
CAS:Formula:C18H36O2Purity:98%Color and Shape:LiquidMolecular weight:284.47722-heptylundecanoic acid
CAS:2-heptylundecanoic acid can be used as a fuel lubricity additive and is commonly used in the pharmaceutical and chemical industries.Formula:C18H36O2Purity:≥98%Color and Shape:SolidMolecular weight:284.48



