CymitQuimica logo

CAS 22952-43-8

:

3-chloro-4-methoxybenzenesulfonyl chloride

Description:
3-Chloro-4-methoxybenzenesulfonyl chloride, with the CAS number 22952-43-8, is an organic compound characterized by its sulfonyl chloride functional group, which is known for its reactivity and utility in organic synthesis. This compound features a chlorinated aromatic ring, specifically a methoxy group (-OCH3) and a chlorine atom positioned at the 4 and 3 positions, respectively, on the benzene ring. The presence of the sulfonyl chloride group (-SO2Cl) makes it a potent electrophile, allowing it to participate in various nucleophilic substitution reactions. It is typically used as a reagent in the synthesis of sulfonamides and other sulfonyl-containing compounds. The compound is generally handled with care due to its corrosive nature and potential to release toxic gases upon hydrolysis. In terms of physical properties, it is usually a solid at room temperature, with solubility in organic solvents. Proper safety measures should be taken when working with this compound, including the use of personal protective equipment and working in a well-ventilated area.
Formula:C7H6Cl2O3S
InChI:InChI=1/C7H6Cl2O3S/c1-12-7-3-2-5(4-6(7)8)13(9,10)11/h2-4H,1H3
InChI key:UMTPXDWZAKJPNY-UHFFFAOYSA-N
SMILES:COc1ccc(cc1Cl)S(=O)(=O)Cl
Synonyms:
  • 3-Chloro-4-Methoxybenzene-1-Sulfonyl Chloride
  • Benzenesulfonyl chloride, 3-chloro-4-methoxy-
Found 4 products.