CAS 22966-11-6
:2-chlorochalcone
Description:
2-Chlorochalcone is an organic compound that belongs to the chalcone family, characterized by its structure, which consists of a phenyl group connected by a carbon-carbon double bond to an α,β-unsaturated carbonyl system. It features a chlorine atom substituted at the second position of the aromatic ring. This compound typically appears as a yellow crystalline solid and is known for its potential biological activities, including antimicrobial and anti-inflammatory properties. 2-Chlorochalcone is often utilized in organic synthesis and as an intermediate in the production of various pharmaceuticals and agrochemicals. Its reactivity is influenced by the presence of the carbonyl group and the halogen, allowing for further chemical modifications. Additionally, it may exhibit interesting photophysical properties, making it a subject of study in materials science and photochemistry. As with many organic compounds, handling should be done with care, considering its potential toxicity and the need for proper safety protocols in laboratory settings.
Formula:C15H11ClO
InChI:InChI=1/C15H11ClO/c16-14-9-5-4-6-12(14)10-11-15(17)13-7-2-1-3-8-13/h1-11H/b11-10+
Synonyms:- 3-(2-Chlorophenyl)-1-Phenylprop-2-En-1-One
- (2E)-3-(2-chlorophenyl)-1-phenylprop-2-en-1-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
(E)-3-(2-Chlorophenyl)-1-phenylprop-2-en-1-one
CAS:(E)-3-(2-Chlorophenyl)-1-phenylprop-2-en-1-oneFormula:C15H11ClOPurity:98%Molecular weight:242.73-(2-Chlorophenyl)-1-phenylprop-2-en-1-one
CAS:3-(2-Chlorophenyl)-1-phenylprop-2-en-1-oneFormula:C15H11ClOPurity:≥95%Molecular weight:242.700242-Chlorochalcone
CAS:2-Chlorochalcone is a synthetic chalcone derivative, which is a type of organic compound belonging to the flavonoid family. It is typically synthesized through the Claisen-Schmidt condensation of 2-chlorobenzaldehyde and acetophenone in the presence of a base catalyst. This synthesis process leverages the carbon-carbon bond formation, which is crucial in generating the characteristic α,β-unsaturated carbonyl system of chalcones.
Formula:C15H11ClOPurity:Min. 95%Molecular weight:242.7 g/mol(E)-3-(2-Chlorophenyl)-1-phenylprop-2-en-1-one
CAS:Formula:C15H11ClOColor and Shape:SolidMolecular weight:242.7002




