CAS 22990-19-8
:1-Phenyl-1,2,3,4-tetrahydro-isoquinoline
Description:
1-Phenyl-1,2,3,4-tetrahydro-isoquinoline is an organic compound characterized by its bicyclic structure, which includes a phenyl group attached to a tetrahydroisoquinoline framework. This compound features a nitrogen atom within a saturated ring system, contributing to its basicity and potential for forming various derivatives. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of the phenyl group enhances its lipophilicity, making it more soluble in organic solvents than in water. This compound is of interest in medicinal chemistry due to its structural similarity to various biologically active molecules, including alkaloids. It may exhibit pharmacological properties, such as analgesic or neuroprotective effects, although specific biological activities can vary. The compound's reactivity can be influenced by the presence of the nitrogen atom and the aromatic phenyl group, allowing for potential modifications in synthetic applications. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken.
Formula:C15H15N
InChI:InChI=1/C15H15N/c1-2-7-13(8-3-1)15-14-9-5-4-6-12(14)10-11-16-15/h1-9,15-16H,10-11H2
SMILES:c1ccc(cc1)C1c2ccccc2CCN1
Synonyms:- 1,2,3,4-Tetrahydro-1-phenylisoquinoline
- Isoquinoline, 1,2,3,4-tetrahydro-1-phenyl-
- 1-Phenyl-1,2,3,4-Tetrahydroisochinoline
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
1-Phenyl-1,2,3,4-tetrahydroisoquinoline
CAS:Formula:C15H15NPurity:>98.0%(GC)(T)Color and Shape:White to Almost white powder to crystalMolecular weight:209.29Isoquinoline, 1,2,3,4-tetrahydro-1-phenyl-
CAS:Formula:C15H15NPurity:97%Color and Shape:SolidMolecular weight:209.28631,2,3,4-Tetrahydro-1-Phenylisoquinoline
CAS:1,2,3,4-Tetrahydro-1-PhenylisoquinolineFormula:C15H15NPurity:98%Color and Shape:SolidMolecular weight:209.29rac-Solifenacin EP Impurity A
CAS:Formula:C15H15NColor and Shape:White To Off-White SolidMolecular weight:209.29rac 1-Phenyl-1,2,3,4-tetrahydroisoquinoline
CAS:Controlled ProductApplications 1-Phenyl-1,2,3,4-tetrahydroisoquinoline is a Solifenacin (S676700) intermediate. 1-Phenyl-1,2,3,4-tetrahydroisoquinoline had been detected in parkinsonian human brain. 1-Phenyl-1,2,3,4-tetrahydroisoquinoline maybe a candidate for endogenous MPTP-like neurotoxin since it is a structural analogue of MPTP which produces parkinsonism in humans.
References Kajita, M. et al.: J. Chrom. B Biomed. Appl., 669, 345 (1995);Formula:C15H15NColor and Shape:NeatMolecular weight:209.291-Phenyl-1,2,3,4-tetrahydro-isoquinoline
CAS:Purity:95.0%Color and Shape:SolidMolecular weight:209.292007446289061-Phenyl-1,2,3,4-tetrahydroisoquinoline
CAS:1-Phenyl-1,2,3,4-tetrahydroisoquinolineFormula:C15H15NPurity:97%Molecular weight:209.29







