CAS 2305-36-4: 2-Amino-4-methylbenzoic acid
Description:2-Amino-4-methylbenzoic acid, also known as p-amino-m-toluic acid, is an aromatic amino acid characterized by its carboxylic acid and amino functional groups attached to a methyl-substituted benzene ring. Its molecular formula is C8H9NO2, indicating the presence of eight carbon atoms, nine hydrogen atoms, one nitrogen atom, and two oxygen atoms. This compound typically appears as a white to off-white crystalline solid and is soluble in water, reflecting its polar functional groups. The presence of the amino group contributes to its basicity, while the carboxylic acid group imparts acidic properties. 2-Amino-4-methylbenzoic acid is often used in organic synthesis and can serve as an intermediate in the production of dyes, pharmaceuticals, and other chemical compounds. Additionally, it may exhibit biological activity, making it of interest in medicinal chemistry. Its melting point and specific reactivity can vary based on environmental conditions and purity, but it is generally stable under standard laboratory conditions.
Formula:C8H9NO2
InChI:InChI=1S/C8H9NO2/c1-5-2-3-6(8(10)11)7(9)4-5/h2-4H,9H2,1H3,(H,10,11)
InChI key:InChIKey=RPGKFFKUTVJVPY-UHFFFAOYSA-N
SMILES:O=C(O)C1=CC=C(C=C1N)C
- Synonyms:
- 2-Amino-4-Methyl Benzoic Acid
- 2-Amino-p-toluic acid
- 4-Methylanthranilic Acid
- Benzoic acid, 2-amino-4-methyl-
- Benzoic acid, 2-amino-4-methyl- (9CI)
- NSC 39155
- Rarechem Al Bo 0820
- p-Toluic acid, 2-amino-
- 2-Amino-4-methylbenzoic acid
