CymitQuimica logo

CAS 23095-14-9

:

5-bromo-2-methoxybenzenesulfonamide

Description:
5-Bromo-2-methoxybenzenesulfonamide is an organic compound characterized by the presence of a bromine atom, a methoxy group, and a sulfonamide functional group attached to a benzene ring. The bromine atom is located at the 5-position, while the methoxy group is at the 2-position of the benzene ring, contributing to the compound's unique reactivity and properties. The sulfonamide group enhances its solubility in polar solvents and can participate in various chemical reactions, making it useful in medicinal chemistry and as a building block in organic synthesis. This compound may exhibit biological activity, potentially serving as an antimicrobial or anti-inflammatory agent, although specific biological properties would depend on further studies. Its molecular structure allows for interactions with biological targets, which is of interest in drug development. As with many sulfonamides, it may also exhibit properties such as moderate stability under standard conditions, but care should be taken regarding its handling and storage due to potential reactivity with strong oxidizing agents.
Formula:C7H8BrNO3S
InChI:InChI=1/C7H8BrNO3S/c1-12-6-3-2-5(8)4-7(6)13(9,10)11/h2-4H,1H3,(H2,9,10,11)
InChI key:WHYIIAFUVXCXIL-UHFFFAOYSA-N
SMILES:COc1ccc(cc1S(=O)(=O)N)Br
Found 4 products.