
CAS 23112-96-1
:2,6-Dimethoxyphenylboronic acid
Description:
2,6-Dimethoxyphenylboronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that has two methoxy substituents at the 2 and 6 positions. This compound typically appears as a white to off-white solid and is soluble in polar organic solvents such as methanol and ethanol, but less soluble in non-polar solvents. It is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis, medicinal chemistry, and as a reagent in Suzuki-Miyaura cross-coupling reactions. The presence of the methoxy groups enhances its electronic properties and solubility, while the boronic acid moiety allows for participation in complexation and sensing applications. Additionally, 2,6-Dimethoxyphenylboronic acid can serve as a building block in the synthesis of more complex organic molecules and is of interest in the development of boron-containing pharmaceuticals. Proper handling and storage are essential due to its reactivity and potential environmental impact.
Formula:C8H11BO4
InChI:InChI=1/C8H11BO4/c1-12-6-4-3-5-7(13-2)8(6)9(10)11/h3-5,10-11H,1-2H3
SMILES:COc1cccc(c1B(O)O)OC
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2,6-Dimethoxyphenylboronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C8H11BO4Purity:97.0 to 111.0 %Color and Shape:White to Almost white powder to crystalMolecular weight:181.982,6-Dimethoxybenzeneboronic acid, 97+%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C8H11BO4Purity:97+%Color and Shape:White to cream, Crystals or powder or crystalline powderMolecular weight:181.98Boronic acid, B-(2,6-dimethoxyphenyl)-
CAS:Formula:C8H11BO4Purity:98%Color and Shape:SolidMolecular weight:181.9815Ref: IN-DA002M7X
1g22.00€10g25.00€5g26.00€25g50.00€50g61.00€100g110.00€250g208.00€500g294.00€1kg541.00€2,6-Dimethoxybenzeneboronic acid
CAS:2,6-Dimethoxybenzeneboronic acidFormula:C8H11BO4Purity:98%Color and Shape:Solid-PowderMolecular weight:181.981542,6-Dimethoxybenzeneboronic acid
CAS:Formula:C8H11BO4Purity:98%Color and Shape:SolidMolecular weight:181.98





