CymitQuimica logo

CAS 231285-91-9

:

3-(iodomethyl)-4-(2,2,3,3,4,4,5,5,5-nonafluoropentyl)pyrrolidine-1-carbonitrile

Description:
3-(Iodomethyl)-4-(2,2,3,3,4,4,5,5,5-nonafluoropentyl)pyrrolidine-1-carbonitrile is a synthetic organic compound characterized by its complex structure, which includes a pyrrolidine ring, a carbonitrile functional group, and a nonafluoropentyl substituent. The presence of the iodomethyl group suggests potential reactivity, particularly in nucleophilic substitution reactions. The nonafluoropentyl group imparts significant hydrophobic characteristics and enhances the compound's lipophilicity, which may influence its solubility and interaction with biological membranes. This compound is likely to exhibit unique physical and chemical properties due to the combination of its halogenated and cyano functionalities. Additionally, the fluorinated segment may contribute to increased thermal and chemical stability. Given its structural features, this compound could have applications in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals, where fluorinated compounds are often sought for their enhanced biological activity and metabolic stability. Safety and handling precautions should be observed due to the presence of iodine and fluorine, which can pose health and environmental risks.
Formula:C11H10F9IN2
InChI:InChI=1/C11H10F9IN2/c12-8(13,9(14,15)10(16,17)11(18,19)20)1-6-3-23(5-22)4-7(6)2-21/h6-7H,1-4H2
InChI key:UTXHMXLRSWWUDH-UHFFFAOYSA-N
SMILES:C(C1CN(CC1CI)C#N)C(C(C(C(F)(F)F)(F)F)(F)F)(F)F
Synonyms:
  • 1-Pyrrolidinecarbonitrile, 3-(Iodomethyl)-4-(2,2,3,3,4,4,5,5,5-Nonafluoropentyl)-
  • 3-(Iodomethyl)-4-(2,2,3,3,4,4,5,5,5-nonafluoropentyl)pyrrolidine-1-carbonitrile
Found 2 products.