CAS 23133-56-4

Physalin B

Description:

Physalin B is a natural compound classified as a steroidal lactone, primarily derived from the plant Physalis angulata, commonly known as the cutleaf groundcherry. This compound exhibits a complex molecular structure characterized by a fused ring system typical of steroidal compounds. Physalin B is known for its various biological activities, including anti-inflammatory, antiviral, and anticancer properties, making it a subject of interest in pharmacological research. The compound has been studied for its potential therapeutic applications, particularly in the treatment of certain cancers and viral infections. Its mechanism of action often involves the modulation of cellular pathways, leading to apoptosis in cancer cells. Additionally, Physalin B's solubility and stability can vary depending on the solvent and environmental conditions, which are important factors to consider in its application and study. Overall, Physalin B represents a significant area of interest in natural product chemistry and medicinal research due to its diverse biological effects and potential health benefits.

Formula: C₂₈H₃₀O₉

InChI: InChI=1S/C28H30O9/c1-23-11-18-25(3)28-19(23)20(30)27(37-28,34-12-16(23)21(31)35-18)15-8-7-13-5-4-6-17(29)24(13,2)14(15)9-10-26(28,33)22(32)36-25/h4,6-7,14-16,18-19,33H,5,8-12H2,1-3H3/t14-,15+,16-,18+,19-,23+,24-,25-,26-,27+,28-/m0/s1

InChI key: InChIKey=HVTFEHJSUSPQBK-DNJDGUCCSA-N

SMILES: C[C@]12[C@]34[C@@]5([C@@]6(C)[C@@](CO[C@](O3)(C5=O)[C@]7([C@](CC[C@]4(O)C(=O)O1)([C@]8(C)C(=CC7)CC=CC8=O)[H])[H])(C(=O)O[C@@]2(C6)[H])[H])[H]

Synonyms:

• (1R,2S,5S,8S,9R,17R,18R,21S,24R,26S,27S)-5-Hydroxy-2,9,26-trimethyl-3,19,23,28-tetraoxaoctacyclo[16.9.1.1~18,27~.0~1,5~.0~2,24~.0~8,17~.0~9,14~.0~21,26~]nonacosa-11,14-diene-4,10,22,29-tetrone
• (1S,2S,3S,6R,6aS,8aR,10aS,10bR,16aR,17R,18aR)-2,3,6,6a,9,10,10a,14,16,16a-Decahydro-8a-hydroxy-2,6a,10b-trimethyl-17,3-(epoxymethano)-1,17:2,6-dimethano-17H-naphtho[1,2-f]furo[3,4-b:2,3-c′]bisoxocin-4,8,11,21(1H,8aH,10bH)-tetrone
• 16,24-Cyclo-13,14-secoergosta-2,5-diene-18,26-dioic acid, 14,17:14,27-diepoxy-13,20,22-trihydroxy-1,15-dioxo-, γ-lactone δ-lactone, (14α,16β,22α,25S)-
• 16α,24-Cyclo-13,14-secoergosta-2,5-diene-18,26-dioic acid, 14α,17:14,27-diepoxy-13,20,22-trihydroxy-1,15-dioxo-, γ-lactone δ-lactone, (20S,22R,24S,25S)-
• 17,3-(Epoxymethano)-1,17:2,6-dimethano-17H-naphtho[1,2-f]furo[3,4-b:2,3-c′]bisoxocin-4,8,11,21(1H,8aH,10bH)-tetrone, 2,3,6,6a,9,10,10a,14,16,16a-decahydro-8a-hydroxy-2,6a,10b-trimethyl-, (1S,2S,3S,6R,6aS,8aR,10aS,10bR,16aR,17R,18aR)-
• Physalin B

Physalin B

CAS: 23133-56-4

Physalin B

Purity: ≥98%

Molecular weight: 510.53g/mol

Ref: 54-BUP00873

Physalin B

CAS: 23133-56-4

Formula: C₂₈H₃₀O₉

Molecular weight: 510.54

Ref: 7W-GY5960

Physalin B

CAS: 23133-56-4

Physalin B is one of the major active compounds from the Solanaceae family of plants and has a wide range of biological activities for the treatment of

Formula: C₂₈H₃₀O₉

Purity: 97.2%

Color and Shape: Solid

Molecular weight: 510.53

Ref: TM-TN2063

Physalin B

CAS: 23133-56-4

Formula: C₂₈H₃₀O₉

Purity: 95%~99%

Molecular weight: 510.539

Ref: BP-BP4290

Physalin B

CAS: 23133-56-4

Physalin B is a natural steroidal compound, which is derived from plants of the genus Physalis, commonly known as ground cherries or lantern fruits. This compound, belonging to the class of withanolides, is isolated primarily from the aerial parts of Physalis species.

Formula: C₂₈H₃₀O₉

Purity: Min. 95%

Molecular weight: 510.5 g/mol

Ref: 3D-YAA13356