CymitQuimica logo

CAS 23218-94-2

:

3-[(2-Ethoxy-2-oxoethyl)amino]benzoic acid

Description:
3-[(2-Ethoxy-2-oxoethyl)amino]benzoic acid, with the CAS number 23218-94-2, is an organic compound characterized by its benzoic acid structure modified with an amino group and an ethoxy-oxoethyl substituent. This compound typically exhibits properties associated with both aromatic and aliphatic functionalities, which can influence its solubility and reactivity. The presence of the carboxylic acid group contributes to its acidity, while the amino group can participate in hydrogen bonding, enhancing its potential as a ligand in coordination chemistry. The ethoxy group adds hydrophobic characteristics, which may affect its interaction with biological systems or other chemical species. This compound may be of interest in pharmaceutical applications due to its potential biological activity, as compounds with similar structures often exhibit various pharmacological properties. Its synthesis and characterization would involve standard organic chemistry techniques, including spectroscopic methods for confirmation of structure and purity. Overall, 3-[(2-Ethoxy-2-oxoethyl)amino]benzoic acid represents a versatile molecule with potential applications in medicinal chemistry and materials science.
Formula:C11H13NO4
InChI:InChI=1S/C11H13NO4/c1-2-16-10(13)7-12-9-5-3-4-8(6-9)11(14)15/h3-6,12H,2,7H2,1H3,(H,14,15)
InChI key:InChIKey=RBDOGNPBVBDZHY-UHFFFAOYSA-N
SMILES:N(CC(OCC)=O)C1=CC(C(O)=O)=CC=C1
Synonyms:
  • Benzoic Acid, 3-[(2-Ethoxy-2-Oxoethyl)Amino]-
  • Benzoic acid, m-[(carboxymethyl)amino]-, m-ethyl ester
  • m-(Ethoxycarbonylmethylamino)benzoic acid
  • 3-[(2-Ethoxy-2-oxoethyl)amino]benzoic acid
Found 3 products.