CymitQuimica logo

CAS 2328094-11-5

:

3-Pyridinecarboxamide, 2-amino-5-[3-(1-piperazinyl)phenyl]-N-4-pyridinyl-

Description:
3-Pyridinecarboxamide, 2-amino-5-[3-(1-piperazinyl)phenyl]-N-4-pyridinyl- is a chemical compound characterized by its complex structure, which includes a pyridine ring and a piperazine moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as potential solubility in polar solvents and the ability to engage in hydrogen bonding due to the presence of amide and amino functional groups. The piperazine ring contributes to its pharmacological properties, often enhancing biological activity and receptor binding. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Its molecular interactions can be influenced by the arrangement of substituents on the aromatic rings, which can affect its efficacy and selectivity in biological systems. As with many compounds containing nitrogen heterocycles, it may exhibit basicity and can participate in various chemical reactions, making it a versatile candidate for further research and application in drug development.
Formula:C21H22N6O
InChI:InChI=1S/C21H22N6O/c22-20-19(21(28)26-17-4-6-23-7-5-17)13-16(14-25-20)15-2-1-3-18(12-15)27-10-8-24-9-11-27/h1-7,12-14,24H,8-11H2,(H2,22,25)(H,23,26,28)
InChI key:YDMJAALVMGFGRY-UHFFFAOYSA-N
SMILES:C1CN(CCN1)C2=CC=CC(=C2)C3=CC(=C(N=C3)N)C(=O)NC4=CC=NC=C4
Synonyms:
  • 3-Pyridinecarboxamide, 2-amino-5-[3-(1-piperazinyl)phenyl]-N-4-pyridinyl-
  • PKC-iota inhibitor 1
Found 6 products.