CAS 23313-21-5

Emodin 8-O-β-D-glucopyranoside

Description:

Emodin 8-O-β-D-glucopyranoside is a glycosylated derivative of emodin, a naturally occurring anthraquinone compound. This substance is characterized by its molecular structure, which includes a glucopyranoside moiety attached to the emodin core, enhancing its solubility and bioavailability. It typically exhibits a yellow to orange color in its pure form and is soluble in polar solvents like water and methanol. Emodin 8-O-β-D-glucopyranoside is known for its potential pharmacological properties, including anti-inflammatory, antioxidant, and anticancer activities, making it of interest in medicinal chemistry and natural product research. Its presence in various plants, particularly those used in traditional medicine, highlights its significance in herbal remedies. The compound's biological activities are attributed to its ability to modulate various signaling pathways, although further studies are needed to fully elucidate its mechanisms of action and therapeutic potential. As with many natural compounds, the specific effects can vary based on concentration, formulation, and the biological context in which it is studied.

Formula:C₂₁H₂₀O₁₀

InChI:InChI=1S/C21H20O10/c1-7-2-9-14(11(24)3-7)18(27)15-10(16(9)25)4-8(23)5-12(15)30-21-20(29)19(28)17(26)13(6-22)31-21/h2-5,13,17,19-24,26,28-29H,6H2,1H3/t13-,17-,19+,20-,21-/m1/s1

InChI key:InChIKey=HSWIRQIYASIOBE-JNHRPPPUSA-N

SMILES:O(C1=C2C(C(=O)C=3C(C2=O)=C(O)C=C(C)C3)=CC(O)=C1)[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O

Synonyms: