CAS 23313-80-6: Epitetracycline hydrochloride
Description:Epitetracycline hydrochloride is a semi-synthetic derivative of tetracycline, classified as an antibiotic. It exhibits broad-spectrum antibacterial activity, primarily targeting Gram-positive and Gram-negative bacteria by inhibiting protein synthesis through binding to the 30S ribosomal subunit. This compound is characterized by its stability in acidic conditions, which enhances its bioavailability. Epitetracycline hydrochloride is typically administered orally and is known for its therapeutic applications in treating various infections, including respiratory and urinary tract infections. The hydrochloride form improves solubility in water, facilitating its use in pharmaceutical formulations. Additionally, it possesses anti-inflammatory properties, making it useful in treating conditions like acne. However, like other tetracyclines, it may cause side effects such as gastrointestinal disturbances and photosensitivity. It is important to note that the use of epitetracycline hydrochloride should be guided by susceptibility testing to avoid resistance development. Overall, this compound plays a significant role in modern medicine, particularly in the treatment of bacterial infections.
Formula:C22H24N2O8·ClH
InChI:InChI=1S/C22H24N2O8.ClH/c1-21(31)8-5-4-6-11(25)12(8)16(26)13-9(21)7-10-15(24(2)3)17(27)14(20(23)30)19(29)22(10,32)18(13)28;/h4-6,9-10,15,25,27-28,31-32H,7H2,1-3H3,(H2,23,30);1H/t9-,10-,15+,21+,22-;/m0./s1
InChI key:InChIKey=XMEVHPAGJVLHIG-DXDJYCPMSA-N
SMILES:Cl.O=C(N)C=1C(=O)C2(O)C(O)=C3C(=O)C=4C(O)=CC=CC4C(O)(C)C3CC2C(C1O)N(C)C
- Synonyms:
- Epitetracycline hydrochloride
- 2-Naphthacenecarboxamide, 4-(dimethylamino)-1,4,4a,5,5a,6,11,12a-octahydro-3,6,10,12,12a-pentahydroxy-6-methyl-1,11-dioxo-, hydrochloride (1:1), (4R,4aS,5aS,6S,12aS)-
- 2-Naphthacenecarboxamide, 4-(dimethylamino)-1,4,4a,5,5a,6,11,12a-octahydro-3,6,10,12,12a-pentahydroxy-6-methyl-1,11-dioxo-, monohydrochloride, (4R,4aS,5aS,6S,12aS)-
- 2-Naphthacenecarboxamide, 4-(dimethylamino)-1,4,4a,5,5a,6,11,12a-octahydro-3,6,10,12,12a-pentahydroxy-6-methyl-1,11-dioxo-, monohydrochloride, [4R-(4α,4aβ,5aβ,6α,12aβ)]-
- 2-Naphthacenecarboxamide, 4-(dimethylamino)-1,4,4a,5,5a,6,11,12a-octahydro-3,6,10,12,12a-pentahydroxy-6-methyl-1,11-dioxo-, monohydrochloride, 4-epimer
