CAS 23403-90-9

L-Tryptophan, L-histidyl-

Description:

L-Tryptophan, L-histidyl- is a dipeptide composed of the amino acids L-tryptophan and L-histidine. This compound is characterized by its structure, which includes the indole side chain of tryptophan and the imidazole side chain of histidine, contributing to its unique biochemical properties. It is known for its role in protein synthesis and may influence various physiological processes, including neurotransmitter regulation and immune response. The presence of both aromatic and polar side chains allows for diverse interactions in biological systems, making it relevant in studies of metabolism and nutrition. Additionally, L-Tryptophan is a precursor for serotonin, a neurotransmitter that plays a crucial role in mood regulation. The CAS number 23403-90-9 uniquely identifies this compound in chemical databases, facilitating research and application in fields such as biochemistry, pharmacology, and nutrition. Overall, L-Tryptophan, L-histidyl- is significant in both structural and functional contexts within biological systems.

Formula: C₁₇H₁₉N₅O₃

InChI: InChI=1S/C17H19N5O3/c18-13(6-11-8-19-9-21-11)16(23)22-15(17(24)25)5-10-7-20-14-4-2-1-3-12(10)14/h1-4,7-9,13,15,20H,5-6,18H2,(H,19,21)(H,22,23)(H,24,25)/t13-,15-/m0/s1

InChI key: FBTYOQIYBULKEH-ZFWWWQNUSA-N

SMILES: C1=CC=C2C(=C1)C(=CN2)C[C@@H](C(=O)O)NC(=O)[C@H](CC3=CN=CN3)N

H-His-Trp-OH

CAS: 23403-90-9

The dipeptide Trp-His shows vasodilatatory activity. Matsui et al. demonstrated that WH inhibits the development of atherosclerosis onsets in ApoE -/- mice.

Formula: C₁₇H₁₉N₅O₃

Purity: > 98%

Color and Shape: Pink Powder

Molecular weight: 341.37

Ref: 01-4001146

H-His-Trp-OH

CAS: 23403-90-9

H-His-Trp-OH is a hydrophobic peptide that belongs to the group of nanomaterials. It has been shown to be resistant to degradation by bacteria and integrates into organisms, providing protection against harsh environments. H-His-Trp-OH has been used in techniques for sequencing DNA and RNA sequences, which have been shown to be sensitive to protonation. This peptide is synthesized using an asymmetric synthesis, which eliminates the need for a charge on the molecule.

Formula: C₁₇H₁₉N₅O₃

Purity: Min. 95%

Molecular weight: 341.36 g/mol

Ref: 3D-FH108069