CymitQuimica logo

CAS 2342-67-8

:

3,3,3-trifluoropropyl 4-methylbenzenesulfonate

Description:
3,3,3-Trifluoropropyl 4-methylbenzenesulfonate, with the CAS number 2342-67-8, is an organic compound characterized by the presence of a trifluoropropyl group and a 4-methylbenzenesulfonate moiety. This compound typically exhibits properties associated with both its fluorinated and sulfonate functional groups, such as increased hydrophobicity and potential reactivity in nucleophilic substitution reactions. The trifluoropropyl group contributes to the compound's stability and can enhance its lipophilicity, making it useful in various applications, including as a reagent in organic synthesis and in the development of pharmaceuticals. The sulfonate group can impart solubility in polar solvents and may also influence the compound's biological activity. Overall, 3,3,3-trifluoropropyl 4-methylbenzenesulfonate is notable for its unique structural features, which can lead to diverse chemical behavior and applications in synthetic chemistry and material science.
Formula:C10H11F3O3S
InChI:InChI=1/C10H11F3O3S/c1-8-2-4-9(5-3-8)17(14,15)16-7-6-10(11,12)13/h2-5H,6-7H2,1H3
InChI key:XQTHZBKUIVFAST-UHFFFAOYSA-N
SMILES:Cc1ccc(cc1)S(=O)(=O)OCCC(F)(F)F
Synonyms:
  • 3,3,3-Trifluoropropyl P-Methylbenzenesulfonate
Found 3 products.